0
Ch and OH bonds are covalent in nature. Ch bond is non -polar while OH bond is polar covalent bond.
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
Salicylic acid formula?
CH2=C=C=C=CH-CH-C=O | \ OH OH CH2=C=C=C=CH-CH-C=O | \ OH OH CH2=C=C=C=CH-CH-C=O | \ OH OH
Is ascorbic acid polar or nonpolar?
Polar. I just answered this question on Mastering chemistry.
What is the structure of 3-bromo-2-butanol?
CH3-CH(Br)-CH(OH)-CH3
Formula for Glycerol?
a trihydric alcohol is called glycerol containing tree hydroxyl groups
What is the chemical formula for tartic acid?
C4H6O6 (Basic formula)HO2CCH(OH)CH(OH)CO2H(Structural formula)
What do ethanol and 1-decanol have in common?
the OH bond AND CH bonds.
Salicylic acid formula?
CH2=C=C=C=CH-CH-C=O | \ OH OH CH2=C=C=C=CH-CH-C=O | \ OH OH CH2=C=C=C=CH-CH-C=O | \ OH OH
What is the equation of 2 iodohexane with sodium methoxide?
CH-ch-ch-ch-ch-ch-naoh--------------->ch3-oh
Is ascorbic acid polar or nonpolar?
Polar. I just answered this question on Mastering chemistry.
Is CH single bond or double bond?
CH compound does not exist. So it has no bonds.
What is cross conjugation?
Cross-conjugation is a special type of conjugation in a molecule, when in a set of three Pi bonds only two pi-bonds interact with each other by conjugation, the third one is excluded from interaction [1]. In classical terms it means that the strict alternation of single and double bonds --CH=CH–CH=CH–CH-- (i.e., conjugated) is interrupted by two consecutive single bonds at each cross-conjugated point in the cross-conjugated pathway: --CH=CH–C(=CH)–CH=CH--. Examples of cross-conjugation can be found in molecules such as benzophenone, divinylether, dendralenes and fullerene. The type of conjugation has an impact on reactivity and molecular electronic transitions.
What is the chemical formula of tartaric acid?
The chemical formula for tartaric acid is HO2C-CH(OH)-CH(OH)-CO2H = (C4H6O6 )
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
What is truncated structural formula for glycerol?
The molecular formula is C3H8O3 The structural formula is CH2(OH)CH(OH)CH2(OH) Propan-1,2,3-triol is commonly noted as C3H5(OH)3.
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
How muCh can i get for mine?
Mu-Ch? CH? Oh that will be 4.99 an ounce if I'm correct. (Which I probably am not)
What is the structure of 3-bromo-2-butanol?
CH3-CH(Br)-CH(OH)-CH3
