0
farmfoods
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What is a chemical of the hexane family?
Hexane is an alkane of six carbon atoms. There ar five different isomers with that particular structure.
Why hexane boiling point is low?
The boiling point of any compound is determined by how much energy it takes to break apart the intermolecular bonds. C6H14 has very low intramolecular forces compared to the polar bonds of another compound, such as water.
Structural formula of heptane?
The chemical equation for Heptane is C2H6.. Wrong Answer. Hepta means 7. Therefore, Heptane has 7 carbon atoms. Since alkanes have the general formula of CnH2n+2, if n is 7, 2n + 2 is 16. Therefore, Heptane has the formula of C7H16.
Is CO2 an example of a chemical equation or a chemical formula?
It is a chemical formula.
What is chemical formula for soap nut powder?
it has no chemical formula. it is a mixture. only compounds have a chemical formula.
What is the chemical formula is hexane?
C6h14
What is difference between hexane and n-hexane?
Hexane is a hydrocarbon with the chemical formula C6H14. n-hexane is the unbranched isomer of hexane as there exists four more branched isomers of hexane
What is a chemical of the hexane family?
Hexane is an alkane of six carbon atoms. There ar five different isomers with that particular structure.
What is the chemical compound C7O6H14?
/\/\/
What is the IUPAC name for butane?
Hexane is the chemical name for Hexane. However another name for Hexane is n-Hexane. Some different isomers of Hexane are: -2-Methylpentane (Isohexane) -3-Methylpentane -2,3-Dimethylbutane -2,2-Dimethylbutane (Neohexane) The chemical formula of Hexane is C6H14.
Which substance can be broken down by a chemical change The answer is Hexane--but why?
Hexane is a compound. All chemical compounds can be broken down by chemical change (chemical reactions of many types) - not only hexane. All the other choices are elements which cannot be broken down by chemical changes.
What is the empirical formula of hexane?
The molecular formula of hexane is C6H14. The empirical formula is the same as the molecular formula after division of all subscripts in the molecular formula by the highest integer that produce an integer quotient from each subscript in the molecular formula. Therefore, the empirical formula of hexane is C3H7.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
2 atoms of carbon 6 atoms of hydrogen and 1 atom of oxygen what is the chemical name?
Many compounds have the chemical formula C6H14; the most common is hexane.
Is heptane the same as hexane?
Hexane is a hydrocarbon with the chemical formula C6H14. n-hexane is the unbranched isomer of hexane as there exists four more branched isomers of hexane
Why hexane boiling point is low?
The boiling point of any compound is determined by how much energy it takes to break apart the intermolecular bonds. C6H14 has very low intramolecular forces compared to the polar bonds of another compound, such as water.
What words start with hex NOT hexagon or hexadecimal?
hexane is a chemical
