0
ethyl ether
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What is the nomenclature for ch3 ch2 ch2 ch2 ch2 ch2 ch2 ch3?
OCTANE
What is ch3-ch2-o-ch2-ch2-ch2-ch2-ch3?
methyl propyl ether
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is CH3-CH2-CH2-F CH3?
Fluoropropane
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the nomenclature for ch3 ch2 ch2 ch2 ch2 ch2 ch2 ch3?
OCTANE
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What type of reaction between chlorine and butane?
This reaction is of a substitution type by a 'alkyl-radical' mechanism:Cl2 + CH3-CH2-CH2-CH3 --> CH2Cl-CH2-CH2-CH3 + HClor (a bit more in favor)Cl2 + CH3-CH2-CH2-CH3 --> CH3-CHCl-CH2-CH3 + HCl
What is ch3-ch2-o-ch2-ch2-ch2-ch2-ch3?
methyl propyl ether
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the name of ch3 ch2 ch2 ch3?
Butane
What is ch3-ch2-nh-ch2-ch3?
diethylamine
What is CH3-CH2-CH2-F CH3?
Fluoropropane
