answersLogoWhite

0


Best Answer

Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful.

"suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.

User Avatar

Wiki User

8y ago
This answer is:
User Avatar
More answers
User Avatar

Wiki User

6y ago

The chemical composition of chloramphenicol is C11H12Cl2N2O5.

This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What is the chemical composition of Chloroamphenicol suspforulation?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

What is chemical composition of kf reagent?

What is the chemical composition of kf reagent


When water evaporates its chemical composition?

The chemical composition remain unchanged.


When ice melts what happens to its chemical composition?

the chemical composition does not change.


Importance or usefulness of chemical composition?

Properties of materials depends on the chemical composition.


What is sandblasting of rock by changing its chemical composition?

No. The chemical composition remains the same.


What is a elemental composition?

This is the composition of a chemical compound expressed in contained chemical elements.


What is chemical composition of phosphorus?

Phosphorus is one of the chemical elements and therefore has no "chemical composition" in the usual sense.


In a physical change some of the physical properties of the substance may be altered and the chemical composition?

No. In a physical change, the substance maintains its chemical composition.


What are the chemical composition for gold dust and chemical formula?

Assuming your gold is pure : Chemical composition = Au Chemical formula = Au


What is the diffence between physical and chemical properties as well an physical and chemical changes?

Physical properties can be observed without changing the chemical composition of a substance. Chemical properties can only be observed by changing the chemical composition of the substance. In a physical change, the chemical composition of the substance does not change. In a chemical change, the chemical composition of the substance changes.


Are rocks a chemical makeup?

Yes, the composition of the rocks is as a result of the distinct chemical composition.


The groups of rocks are classified by?

i think is chemical composition its not chemical composition, it's how they were formed