Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful.
"suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.
The chemical composition of chloramphenicol is C11H12Cl2N2O5.
The chemical composition remain unchanged.
the chemical composition does not change.
No. The chemical composition remains the same.
This is the composition of a chemical compound expressed in contained chemical elements.
Properties of materials depends on the chemical composition.
What is the chemical composition of kf reagent
The chemical composition remain unchanged.
the chemical composition does not change.
Properties of materials depends on the chemical composition.
No. The chemical composition remains the same.
This is the composition of a chemical compound expressed in contained chemical elements.
Phosphorus is one of the chemical elements and therefore has no "chemical composition" in the usual sense.
No. In a physical change, the substance maintains its chemical composition.
Assuming your gold is pure : Chemical composition = Au Chemical formula = Au
Physical properties can be observed without changing the chemical composition of a substance. Chemical properties can only be observed by changing the chemical composition of the substance. In a physical change, the chemical composition of the substance does not change. In a chemical change, the chemical composition of the substance changes.
Yes, the composition of the rocks is as a result of the distinct chemical composition.
i think is chemical composition its not chemical composition, it's how they were formed