Air is made up of 16% Oxygen, 1% Hydrogen, and 78% Nitrogen but the actual formula is not very known. Does anyone knowwhat the actual is when they are put together and not just three elements alone?
i would say that air doesnt have a chemical formula because the parts are not chemically combined, therefore, air is a mixture.
The actual mixture of air is 78.084% Nitrogen, 20.946% Oxygen, 0.934% Argon, 0.033% Carbon Dioxide. This does very slightly due to environmental conditions.
There in no such thing. Air is a mixture of gases just like sea water is a mixture of water and several ions.
About 78% of air is nitrogen molecules N2, 21% is oxygen molecules O2 and the balance is carbon dioxide CO2, water vapour, and some other gases such as argon.
Air is a mixture so, it can not have an equation. Its composition is about 78% nitrogen(N2), about 21% oxygen(O2), about .9% argon(Ar), and the rest is very small amounts of other stuff (CO2, Ne, He, Kr, CH4, and H2).
There is no formula for air. Air is made up of many different Gases. The 4 main ones are: Nitrogen[N] 77% (Roughly)
Oxygen[O2] 22% (Roughly)
Argon[Ar] 0.9% (Roughly)
Carbon Dioxide[CO2] 0.01% (Roughly)
There is no formula for air because it is a mixture of gases and not a pure substance. The two most abundant gases are nitrogen at 78% and oxygen at 21%.
the chemical compoud of air is oxygen the chemical compoud of air is oxygen
Air is a mixture of a lot of substances. O2 is what we use to breathe, but N2 is most commonly found in regular air (approx. 80%).
Co2H2O2
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
O2
The chemical formula for oxygen is O2.
In terms of scientific matter the formula for Fluoric acid is HFO2. Though it is unlikely that such a compound exists.
The chemical formula for pyrite is FeS2, which is iron sulfide.
There is no formula for scientific energy.
the scientific formula is H2O
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
"2 plus 2" is not a scientific formula. In fact, it is not a formula of any sort.
Formula: Na3P
Mass
O2
water
The chemical formula for oxygen is O2.
It is table sugar put into a scientific formula.
AgNO3.
The scientific expression is solid-air aerosols.