0
As the name implies hair detangler is a product that helps your hair get tangle free with a painless process. It has ingredients that leaves your hair smooth and shiny.
Wiki User
∙ 9y ago
Add your answer:
Earn +20 pts
What is the chemical composition for hair shampoo?
Its chemical formula is CH3(CH2)10CH2(OCH2CH2)nOSO3Na
What is the chemical name for formula?
chemical formula
What is the chemical formula for SnCl4?
That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.
What are the examples of salt and their chemical formula?
Copper sulfate, chemical formula CuSO4Sodium chloride, chemical formula NaClSodium chromate, chemical formula H2CrO4Mercury sulfide, chemical formula HgSCalcium carbonate,CaCO3
What is the chemical formula for CF?
CF is the chemical formula.
What is in horses hair detangler?
Horse Detangler is typically made of silicon and other oily substances.
Are there hair detangler product?
yes there is its at the store.
What do you use on your hair when you have nappy hair?
I use a detangler or take a shower.
How do you make your hair easy to comb?
detangler spray
How do you make a hair detangler?
You can make natural hair detangler by mixing a cup of water with a teaspoon of natural oil in a spray bottle. Add a few drops of essential oil for fragrance.
What is the chemical formula of hairspray?
There are many kinds of hair dye, each of which is a mixture of many chemical compounds. There's no one chemical formula for hair dye.
How do you keep your hair from being tangled?
Always use conditioner when you shower and when you brush your hair, use detangler.
How do you spell detangerler?
The likely word is "detangler" (hair tangle treatment or brush).
How do you get a big knot out of your hair?
Go in the shower and wash your hair and then put conditioner on your knot and scrub it really good. (Or you can use detangler)
What is the chemical composition for hair shampoo?
Its chemical formula is CH3(CH2)10CH2(OCH2CH2)nOSO3Na
How do you get rid of really bad knots in your hair?
What not to do is brush it frantically hard because that can make it worse. Instead, gently tease bits of hair knotted away, strand by strand. Gently use a comb tohelp untangle the knot. Be gentle and patient. Also spraying it with a detangler will help unreil the knot. Use water if you have no detangler.
What is the formula for chemical energy?
Energy has no chemical formula as it is not a chemical.
