0
What is the condensed structural formula for 2 3-dimethylpentane?
Wiki User
∙ 8y ago
H3C-CH=CBr-CH2-CH3
A 5 carbon chain with a one double bond between the 2nd and 3rd carbon atoms, and a bromine bound to the third carbon in the chain. Implicit hydrogens filled up to 4 bonds per carbon.
Wiki User
∙ 14y ago
Wiki User
∙ 14y agoCondensed structure is writing out the molecules with letters and parantheses, without bonds:
2,3-diflouro-1-pentene
CH2CFCHFCH2CH3
Add your answer:
Earn +20 pts
What is the condensed structural formula for 4-bromo-2-pentanone?
The formula is C5H9BrO.
What is the condensed formula for 5-isopropyl-2-methylheptane?
This formula is C11H24.
What is the condensed structural formula for 1-2-4-trichlorobenzene?
C6H3Cl3 The benzene ring has 6 carbon atoms, each of which is given a number and this continues in a clockwise direction. Chlorine atoms are attached to carbons 1, 2 and 4.
Structural formula of CH3-CH equals CH-CO-H?
This is already a structural formula CH3-CH=CH-CHO of 2- butenal or Butanal-2-en
What is the structural formula of 1 2 ethanediol?
(ch2-oh)
What is the condensed structural formula for 4-bromo-2-pentanone?
The formula is C5H9BrO.
What is the condensed structural formula for 2 4-Dimethylphenol?
The chemical formula of 2,4-dimethylphenol is C8H10O.
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?
Ch3ch(ch3)ch(ch2ch3)ch2ch(ch3)ch2ch2ch3
What is the condensed structural formula for ethyne?
the formula for the compound is C2H2 to express this in its simplest form devide each atom be a common number, here we can see that there is 2 of each atom so an emperical formula would be CH
What is 2-hexenal condensed formula?
The chemical formula of 2-hexenal is C6H10O.
What is the condensed formula for 5-isopropyl-2-methylheptane?
This formula is C11H24.
What would be the empirical formula of octane?
the structural formula for octane(straight chain) is CH3 CH2 CH2 CH2 CH2 CH2 CH2 CH3
What is the Molecular formula for 2-butyne?
What is the molecular formula of 2-Butyne
Iodide ion formula?
H H H| | |H-C-C-C-H| | | H I HA complete structural formula will show all bonds
What is the condensed structural formula for 1-2-4-trichlorobenzene?
C6H3Cl3 The benzene ring has 6 carbon atoms, each of which is given a number and this continues in a clockwise direction. Chlorine atoms are attached to carbons 1, 2 and 4.
What is the structural formula of 2-methylbutan-2-ol?
yoyoy
