Want this question answered?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
No. Sodium acetate solution is a homogeneous mixture, which is a solution. Sodium acetate is an ionic compound formed from sodium ions and acetate ions. Sodium in sodium acetate no longer has the properties of sodium metal.
I dont know dont ask me
The dissociation of sodium phosphate is; Na3PO4(aq) -> 3Na+(aq) + PO43-(aq)
Sodium acetate or sodium ethanoate or E262.
C2H3NaOO
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
sodium acetate = Na+C2H3O2- (a salt) nitric acid = HNO3 equation: NaC2H3O2 + HNO3 --> NaNO3 + C2H4O2
The equation is: NaCl----------Na++ Cl-
a complex compound should be formed between iron and acetate group
sss
2CH3COONa+H2SO4 ---> 2CH3COOH+Na2SO4
No. Sodium acetate solution is a homogeneous mixture, which is a solution. Sodium acetate is an ionic compound formed from sodium ions and acetate ions. Sodium in sodium acetate no longer has the properties of sodium metal.
All elements are disassociated so there is no net Ionic equation
I dont know dont ask me
The dissociation of sodium phosphate is; Na3PO4(aq) -> 3Na+(aq) + PO43-(aq)
sodium acetate and zinc phosphate