0
the ester formed is methyl benzoate which is also known as oil of wintergreen
Wiki User
∙ 15y ago
Add your answer:
Earn +20 pts
Is methyl benzoate an ester?
Methyl benzoate, an organic compound, is an ester. It is a colorless liquid that is not soluble in water and has a fruity smells. Some uses for methyl benzoate are as a solvent and a pesticide.
What is the molecular structure of orange oil?
its an octyl acetate, that is an ester in which an 8 carbon strand is conected to the o and a methyl attached to the carbonyl.
Why initial products of the saponification of methyl benzoate soluble in water?
Saponification is a term used where soaps are formed as from fats and oils (triglycerides), methyl benzoate is a simple ester so here we may use the term hydrolysis, the reaction is performed in presence of NaOH so initial products are in ionic or salt form, sodium benzoate and sodium methoxide so are soluble in water.
Is potassium benzoate a sweetener?
Potassium benzoate levels of potassium are different in each chemical manufactures mixture. The information is not commonly available without purchasing the product.
Isopropyl alcohol plus cinnamic acid yield what ester?
The ester formed is Iso-propyl cinnamate.
What ester is formed when acetic acid reacts with octyl alcohol?
It forms Octyl Acetate.
Ester formed between 1-octanol and glacial acetic acid?
Octyl Acetate
What combination of alcohol and acid will form octyl benzoate?
Benzoic acid and n-octyl alcohol in presence of sulphuric acid on heating form octyl benzoate and water.
Is methyl benzoate an ester?
Methyl benzoate, an organic compound, is an ester. It is a colorless liquid that is not soluble in water and has a fruity smells. Some uses for methyl benzoate are as a solvent and a pesticide.
Octyl formate has flavor oranges name the alcohol and the caborxylic acid needed to synthesis this ester?
octyl alcohol and formic acid
What is the Prepration of phenyl benzoate from phenol?
reacting a benzoyl chloride with a phenol to get an phenyl benzoate(ester).
What is Sucrose Benzoate?
Sucrose Benzoate, which is made industrially is actually a disaccharide ester. Due to its properties, it is widely used as one of the food packaging adhesive components.
What is the molecular structure of orange oil?
its an octyl acetate, that is an ester in which an 8 carbon strand is conected to the o and a methyl attached to the carbonyl.
What ester is produced from ethanol and benzoic acid and sulfuric acid and what odor does it give off?
Ethyl Benzoate
Orange tastes like?
Oranges taste and smell like Octyl acetate, or octyl ethanoate. It is an organic compound with the formula CH3(CH2)7O2CCH3. It is an ester as are most fruity odours . The smell of an orange is similar to Limonene (a cyclic terpene).
Why initial products of the saponification of methyl benzoate soluble in water?
Saponification is a term used where soaps are formed as from fats and oils (triglycerides), methyl benzoate is a simple ester so here we may use the term hydrolysis, the reaction is performed in presence of NaOH so initial products are in ionic or salt form, sodium benzoate and sodium methoxide so are soluble in water.
What is the ester formed from acetic acid and n-pentyl alcohol?
Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.
