0
The ester formed is Iso-propyl cinnamate.
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
What classification of alcohol undergoes oxidation to yield a ketone?
A secondary alcohol undergoes oxidation to yield a ketone; a primary alcohol forms an aldehyde instead, and a tertiary alcohol usually does not form either a ketone or an alcohol, because the carbon having the OH group in a tertiary alcohol already has three bonds to other carbon atoms and therefore cannot form a double bond to oxygen without more extensive breaking of other bonds in the tertiary alcohol.
Does the Krebs cycle start with pyruvic acid and yield lactic acid or alcohol?
lactic acid
What are the product of lipase reaction?
Pancreatic lipase may: hydrolyze triacylglycerols to yield 1,2-diacylglycerol and a fatty acid. It may also hydrolyze 1,2-diacylglycerol to yield 2-monoacylglycerol and a fatty acid. Pancreatic lipase may not hydrolyze 2-monoacylglycerol, because the enzyme is spesific for the primary ester links--> position 1 and 3 in triacylglycerols. But, intestinal isomerase may convert 2-monoacylglycerol to 1-monoacylglycerol. Then, pancreatic lipase can hydrolyze 1-monoacylglycerol to yield a fatty acid and glycerol. :)
How is percent yield caculated?
Percent yield = (actual yield/expected yield) x 100
How do you calculate percentage yield?
# Determine the limiting reagent; # Calculate the expected yield if the reaction goes to 100% completion. # Divide the actual yield by the expected yield and multiply by 100. The result is percentage yield.
What is the fragrance produced by isoamyl alcohol and butyric acid?
In the more advanced organic chemistry labs, many introduce fisher esterification by using combinations that yield appealing scents to the students. This specific reaction, when run with small amounts of H2SO4 and one of the reactants in excess will yield an ester with a distinct smell - Bananas. Isoamyl acetate is also the pheromone bees use as a natural alarm, be careful Similar reactions are run to yield Pineapple oil (ethyl butanoate from ethanol and butanoic acid) and strawberry oil (methyl trans-cinnamate from trans-cinnamic acid with methanol)
What ester is produced from salicylic acid and methyl alcohol?
Organic acids and alcohols are reacted (in the presence of a dehydrating agent) to produce esters. And these substances are often recognized by their characteristic odors. In the case here, salicylic acid and methyl alcohol yield methyl salicylate, which is winter-green.
How much alcohol content does fermentation yield?
About 17%.
What classification of alcohol undergoes oxidation to yield a ketone?
A secondary alcohol undergoes oxidation to yield a ketone; a primary alcohol forms an aldehyde instead, and a tertiary alcohol usually does not form either a ketone or an alcohol, because the carbon having the OH group in a tertiary alcohol already has three bonds to other carbon atoms and therefore cannot form a double bond to oxygen without more extensive breaking of other bonds in the tertiary alcohol.
Why cholesterol is considered as a non-saponifiable lipid?
It will not react with a base which would yield a salt and an alcohol.
Does the Krebs cycle start with pyruvic acid and yield lactic acid or alcohol?
lactic acid
Why cholesterol is considered as a non saponifiable lipid?
It will not react with a base which would yield a salt and an alcohol.
Will an EtG urine test yield a definite BAC level?
No. It only indicates that alcohol has recently been in the body.
Would a sip of wine yield a positive urine drug test?
No. Alcohol isn't going to cause a positive drug test.
What is the ester formed from acetic acid and n-pentyl alcohol?
Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.
Why are spirits distilled?
Spirits are distilled in order to get a purer form of alcohol than normal brewing and fermentation can yield. The mash is brewed and fermented to produce the alcohol and then heated to evaporate the alcohol away from the mash into a cooling device to collect in a separate container. Since alcohol has a lower boiling point than water, the evaporate contains a higher concentration of alcohol
How does acetophenone yield 2-phenyl-2-butanol?
Acetophenone can be converted into 2-phenyl-2-butanol using a Grignard reagent. Using CH3MgI, the carbonyl group of acetophenone will be attacked by this reagent and yield the alcohol: 2-phenyl-2-propanol.
