3-Hexene: CH3CH2CH=CHCH2CH3 to name alkenes: -identify the parent chain (how many carbon atoms are in formula=prefix) there are 6 carbon atoms so the prefix is "hex" (prefixes are online) then add the end of the word alkene --> "ene" to that prefix. -Label where the double bond is located (on which carbon atom that has the lowest numeral positioning, numbering from either side) 3-hexene, you know that the double bond is at the 3rd carbon atom -the hydrogen atoms are determined by the number of covalent bonds the carbon atom can have (4) the first "C" has 3 hydrogen atoms bonded to it because it's only using one bond the second "C" has only 2 because its bonding in front and behind it (using 2) the third "C" has 1, the double bond takes 2 and the bond behind uses 1 (3) hope this helps -Autumn
2-methylcyclohexene does not exist. It is actually 1-methylcyclohexene. 2-methylcyclohexene indicates that the methyl group is bonded to one side of a carbon-carbon double bond in a six-carbon ring. The double bond tells you where to start numbering. Therefore, the methyl group would actually be on carbon #1. The only way to have 2-methylcyclohexene is if there is another group attached to the ring that changes the numbering.
c7H12 is the formula
Edit (9/23/14): The Methyl group is numbered 2 to indicate that the double bond present in the molecule, indicated by the "-ene" suffix, is on the first carbon. In the naming system the double bond is given numerical priority over the substituents. This means that 2-methylcyclohexene is a 6C ring with a double bond present between the first and second Carbons, and a methyl group substituent (CH3) on the second Carbon. The part about C7H12 is correct though.
what is the molecular formula of 3-methyl-2-hexanol
The organic compound 2-hexene that is commonly used as a comonomer in production of polyethylene. The molecular formula for 2-hexene is C6H12.
C6h12
ch3ch=ch(ch2)2ch3
ch3ch=chch2ch2ch3
Ch3 ch2 c=c ch(ch3)2
molecular formula :]-kyrstiann dynae :]
a molecular formula
It would be a molecular formula for C3h5o.
Imperical fomula is C2H4.Molecular fomula is C4H8.
The Molecular Formula is: CaCO3
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
a molecular formula
molecular formula :]-kyrstiann dynae :]
It would be a molecular formula for C3h5o.
CCl4 is the molecular formula for carbon tetrachloride. It is the same as its empirical formula.
Imperical fomula is C2H4.Molecular fomula is C4H8.
The molecular formula for Starch is C6H10O5.
The molecular formula of methane is CH4
The Molecular Formula is: CaCO3
The molecular formula for Oxygen is O2
NO2 is the molecular formula for NO2.
CCl4 is molecular formula.