0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the hybridization of the central atom in ccl4?
Prsumably you mean AlH4- the tetrahydroaluminate anion. The hybridization of the central atom of AlH4 is sp3.
What is 2-2-4-4-tetramethylpentane?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the hybridization of PH3?
The hybridization of PH3 is sp3
What is the hybridization of ion CH3 plus?
This carbocation which only has six electrons is isoelectronic with BH3 and is believed to have a similar structure as gaseous molecular BH3, planar with bond angles of 120 0. The hybridisation would be sp2 with and empty p orbital.
What is the shape bond angle and hybridization of plus CH3?
CH3 is a trigonal planar and has a hybridization of sp3
What are the hybridization of the carbon atoms in CH3 CH2 COH?
The C in h3c is sp3 hybridized The c in ch is sp2 hybridized the c in ch2 is sp2 hybridized
What is the hybridization of the central atom in ccl4?
Prsumably you mean AlH4- the tetrahydroaluminate anion. The hybridization of the central atom of AlH4 is sp3.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Chemical reaction of 2-Butene?
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
What is 2-2-4-4-tetramethylpentane?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
