0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the expanded structure and IUPAC name for CH2C equals OCH2CH3?
Are you sure this is correct? CH3C=OCH2CH3 would make more sense.
Why isn't propyne called 1-propyne?
Propyne is not called 1-propyne because the prefix "1-" is used to indicate the location of a functional group on a carbon chain when there are multiple sites of attachment. In the case of propyne, there is only one carbon in the chain, so no numbering is needed.
What is the structural formula of propyne?
The chemical formula of propyne is CH3C≡CH.
What is the chemical formula for nail varnished?
A main component is acetone [propanon, CH3C(O)CH3 ], but sometimes butyl- and pentyl esters are also involved.
What is a chemical formula for a acid?
the chemical formula for periodic acid is HIO4
What is the expanded structure and IUPAC name for CH2C equals OCH2CH3?
Are you sure this is correct? CH3C=OCH2CH3 would make more sense.
Why isn't propyne called 1-propyne?
Propyne is not called 1-propyne because the prefix "1-" is used to indicate the location of a functional group on a carbon chain when there are multiple sites of attachment. In the case of propyne, there is only one carbon in the chain, so no numbering is needed.
What is a balanced chemical equation for propylethanoate?
The word eq'n is Ethanoic acid + propanol = propylethanoate + water. The chemical equation is CH3C(=O)-OH + CH3CH2CH2OH CH3C(=O)-O-CH2CH2CH3 + H2O)
Which substance is butyne A. CH3CH2CH2CH3 B. CH3CH CHCH3 C. CH3C CCH3 D. CH3 C?
C 4 carbons is where you get the "but" (butane). the three "C's" next to each other (in answer C) tells me that it has a triple bond, which is the Alkyne functional group. Alkyne's end with "-yne". At least that's what I think, hopefully someone smart will come along and properly explain it, I'm just now learning it and so to my limited knowledge, I do believe it's C.
What is the condensed structural formula of hexyl acetate?
Ch3c(=o)(-o-)ch2ch2ch2ch2ch2ch3
Ionic compound name for mo(c2h3o2)?
Molybdenum ethanoate. Mo^(+) [ CH3C(=O)-O^-]
What compounds contains both ionic and covalent bonds NaNO3 CH3Cl C2H3OH NH2OH H2O2 CH3C?
NaNO3
What is the chemical equation that indicates the production of butanol from butanone?
The reaction is:CH3CH(OH)CH2CH3 = CH3C(O)CH2CH3 + H2
What is the structural formula of propyne?
The chemical formula of propyne is CH3C≡CH.
Water heavy metal test why you are use thioacetamide as a reagent?
Thioacetamide is used to provide metal sulphides, which will produce colour for comparison of test and standard (Pb ppm). M2+ + CH3C(S)NH2 + H2O ----> MS + CH3(CO)NH2 + 2H+Where, M is metal ion, CH3C(S)NH2 is Thioacetamide, MS is Metal sulphide.
What is the chemical formula for nail varnished?
A main component is acetone [propanon, CH3C(O)CH3 ], but sometimes butyl- and pentyl esters are also involved.
Pyruvate is made of how many carbons?
It has three carbon atoms.Pyruvate is the anion of pyruvic acid: CH3C(=O)COOH , IUPAC name: 2-oxopropanoic acid
