0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What ester does butyric acid and amyl alcohol form?
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
What you combine to produce an ester?
RCOOH + R'OH ---> ester + water
Are polysaccharides bonded by ester?
No. they are bound by ether linkage, not ester
What is the difference between a partial ester and an ester?
it was red and it was red because the desiples belived that ester was a sad moment for ther religan so they were red
When bonded what do fatty acids and glycerol form?
Ester bonds. For example, "A triglyceride (TG, triacylglycerol, TAG, or triacylglyceride) is an ester derived from glycerol and three fatty acids."-wikipedia on triglyceride
What smell does the ester from n-amyl alcohol and acetic acid have?
banana
How would you notice the presence of esters in fruit such as pinneapple?
Esters are aromatic, you would smell them - the smell of pineapple is an ester.
Why does the smell of an ester become more prominent when it is poured into water?
Mr. Yahia Maharmeh says that Because the reactions are slow and reversible, you don't get a lot of ester produced in this time. The smell is often masked or distorted by the smell of the carboxylic acid. A simple way of detecting the smell of the ester is to pour the mixture into some water in a small beaker.Apart from the very small ones, esters are fairly insoluble in water and tend to form a thin layer on the surface. Excess acid and alcohol both dissolve and are tucked safely away under the ester layer.
What does a banana smell like?
The smell is difficult or impossible to compare except in relation to other subjective smells. Part of the smell consists of an ester called isoamyl acetate, also found in pears. The human nose would probably find it difficult to distinguish between the presence of the chemical and the presence of an actual banana. The ester is also found in bees, where it is a pheromone released when the bee stings.
What is an observable characteristic of an ester?
Esters are used for perfumes, or artificial flavoring. It smells sweet, typically.
Is there an ester in ATP?
No. There is not an ester.
What nicknames does Zani Ester go by?
Zani Ester goes by Ester.
What organic material forms whaen Alcohol and acid mix?
It makes Ester ! :) ^^
What ester does butyric acid and amyl alcohol form?
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
Orange tastes like?
Oranges taste and smell like Octyl acetate, or octyl ethanoate. It is an organic compound with the formula CH3(CH2)7O2CCH3. It is an ester as are most fruity odours . The smell of an orange is similar to Limonene (a cyclic terpene).
What is the birth name of Ester Lindgren?
Ester Lindgren's birth name is Ester Astrid Lindgren.
What is the birth name of Ester Formosa?
Ester Formosa's birth name is Ester Formosa Plans.
