answersLogoWhite

0


Best Answer

C14H9Cl5.

User Avatar

Wiki User

12y ago
This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What is the structural formula for dichloro diphenyl trichloroethane?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

What is the formula trichloroethane?

Formula: C2H3Cl3


What is 1-3-dichloro-3-methylheptane in a condensed structural formula?

CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2


What is the chemical formula of trichloroethane?

C2H3Cl3


CH3CH2OH is the structural formula for what compound?

The structural formula CH3CH2OH describes ETHANOL.


What is the Structural formula for 3-methyl-1-butene?

structural formula of c5h10


How does a complete structural formula differ from a condensed structural formula?

------ The condensed structural formula is simply a shortened version of the complete structural formula. -------The complete formula indicates all of the carbon and hydrogen atoms. The condenced formula groups the hydrogen atoms with each of the carbon atoms.


What is the structural formula for aspirin?

The structural formula of aspirin is HOOC-C6H4-OCOCH3(C9H8O4).


What is structural formula of 3-oxopentanal?

The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.


What is the chemical and structural formula of methane?

The chemical formula for methane is CH4. Refer to the related link for the structural formula.


What is the structural formula for sodium nitrite?

Structural: NaONO


How does a complete structural formula differ from condensed formula?

The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.


What is the difference between a chemical formulamolecular formula and a structural formula?

A structural formula represents the molecule graphically, whereas the other does not.