0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What are CH and OH bonds?
Ch and OH bonds are covalent in nature. Ch bond is non -polar while OH bond is polar covalent bond.
What type of compound is ch-o-ch-ch-ch?
ether
Monomer of benzene?
As the molecular formula for benzene is C6H6 so acetylene CH Triple Bond CH should be its monomer.
What bond type does polypropylene have?
Covalent bonding. Polypropylene is a polymer its structure is shown as -[-CH(CH3)-CH2-]- n It monmer is propene ( CH2=CH-CH3 ) One bond of the double bond breaks open and combines with another 'broken' propene double bond to becomes a larger chain . THe whole is covalently bonded throughout.
What is the structure of 4-methyl-4-nonene?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
Is CH single bond or double bond?
CH compound does not exist. So it has no bonds.
What type of bond is in a lipid?
Nonpolar CH bonds. Ester linkages occur.
What are CH and OH bonds?
Ch and OH bonds are covalent in nature. Ch bond is non -polar while OH bond is polar covalent bond.
What is the correct name for the compound CH3CH2CH(DOUBLE BOND)CH-CH2-CH(DOUBLE BOND)CH-CH?
You think probable to cycloocta-1,5-diene.
What is the reaction of acetylene with bromine?
CH (triple bond) CH + Br2 -> BrC (triple bond) CBr
In organic chemistry what kind of bond is a peptide bond?
This type of bond exists in proteins, it is amide bond formed between nitrogen atom of one molecule and carbonyl carbon of 2nd molecule , as R-CO-NH-CH(R)-CO-
What type of compound is ch-o-ch-ch-ch?
ether
What is the of 4 4?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
Monomer of benzene?
As the molecular formula for benzene is C6H6 so acetylene CH Triple Bond CH should be its monomer.
What is the structural formula of propyne?
The chemical formula of propyne is CH3C≡CH.
What do ethanol and 1-decanol have in common?
the OH bond AND CH bonds.
What does the single straight line mean in -CH in elements?
single bond
