0
Pyridine itself (unsubstituted) is basic due to presence of lone pare of electron on nitrogen atom which is not involved in aromatic character , methyl at 4th (Para) position is electron donor due to hyper-conjugation so electrons density at nitrogen becomes increase so 4-methyl pyridine is more basic as compare to unsubstituted pyridine.
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
What is the best route for synthesis of pyridine-4-acetaldehyde?
What is the best route for synthesis of pyridine-4-acetaldehyde?
What is the action of caustic soda on colour of phenolphtalein?
Basic materials and any weak acid solution with pH above 4 turn Methyl Orange into orange-yellow
What chemicals contain 4 hydroxy methyl 2?
"4 hydroxy methyl 2" is nonsense, chemically speaking. It looks like you left out part of the compound name, rendering the question unanswerable.
What is the club drug nicknamed stp?
2,5-dimethoxy-4-methyl-amphetamine (DOM, STP) A very powerful hallucinogen
What is the total number of carbon atoms in a molecule of 2 methyl and 4 ethyloctane?
11
What is the best route for synthesis of pyridine-4-acetaldehyde?
What is the best route for synthesis of pyridine-4-acetaldehyde?
Why methyl amine is a stronger base than ammonia?
Because methyl is an electron pumping group and It pumps electrons to Amine group to make it basic, But Ammonia has no influence from any basic groups. Therefore compared to Methyl-Amine, Ammonia is less basic
What is Karl fischer composition?
The main contents of karlfisher reagents are 1.Dichloro methane 2.Iodine 3.So2 4.Pyridine in latest stage the pyridine is replaced by Immidazole
What is the structure of 4-methyl-4-nonene?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is the action of caustic soda on colour of phenolphtalein?
Basic materials and any weak acid solution with pH above 4 turn Methyl Orange into orange-yellow
What is the IUPAC name of cresol?
o Cresol 2-methyl phenol m Cresol 3-methyl phenol p- Cresol 4- methyl phenol
What is the scientific name of the methyl orange?
IUPAC name for methyl orange is: 4-dimethylaminoazobenzene-4'-sulfonic acid sodium saltformula: C14H14N3NaO3SOther name: p-dimethylamino-azobenzenesulfonic acidStructural formula of Methyl Orange can be viewed in 'Related links' just below this answer page.
What is the of 4 4?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is the dehydration of 4 methylcyclohexanol?
The dehydration of 4-methylcyclohexanol yields only one product, 4-methylcyclohexene. --Ron Actually, at least three different isomers of methyl cyclohexene are produced. 1 methyl cyclohexene, 3-methyl cyclohexene and 4-methyl cyclohexene. It is a fascinating reaction undergoing a lot of recent study. It is becoming the classic example of the "Evelyn Effect" wherin the proportions of different products of a reaction vary with time as a result of the fact that the rates of the processes generating the different products differ in themselves. See http://ochemonline.pbwiki.com/f/Dehydration_Blog.doc for more information. - GM
What is the reaction between acrylic acid and titanium dioxide?
what is the reaction mechanism between acrylic acid,4-vinyl pyridine
Colour of methyl orange in sodium hydroxide?
acids wont change their color in methyl orange. bases changes the color when they are present in methyl orange.HCl is white or no color in methyl orange.Added:Red > orangy-yellow
How does methyl orange work in acidic and basic solution?
Methyl orange is an acid/base indicator changing from orange-yellow to red when pH lowers from 4.4 to 3.1, thus indicating the endpoint (pH ~ 4) of the 'bicarbonate (HCO3-) to carbonic acid (H2CO3)'-titration with dilute strong acid (HCl).
