0
Cch3ch2ch2ch2cohohh this is the structure of which organic compound
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What is the structural formula of 2-ethyl hexane?
CH3-CH=CH2-CH2-CH2-CH3 CH3
What would be the empirical formula of octane?
the structural formula for octane(straight chain) is CH3 CH2 CH2 CH2 CH2 CH2 CH2 CH3
What is the chemical and structural formula of 4-nonene?
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
Ethyl butyrate structural formula?
H_ ..... _H H_C=C_H In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
What is the structural formula of 2-ethyl hexane?
CH3-CH=CH2-CH2-CH2-CH3 CH3
Condense structural formula of methyl pentanoate?
Ch3-ch2-ch2-ch2-c(=o)-o-ch3
What is propene condensed structural formula?
Ch2chch3 c=c-c
What would be the empirical formula of octane?
the structural formula for octane(straight chain) is CH3 CH2 CH2 CH2 CH2 CH2 CH2 CH3
What is the chemical and structural formula of 4-nonene?
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
What is the structural formula of 3 - methylnonane?
It is a straight carbon chain composed of nine carbons with a methyl (-CH3) group attached to the third carbon. CH3-CH2-CHMe-CH2-CH2-CH2-CH2-CH2-CH3
What is the correct condensed structural formula for 1-pentene?
It is CH=-C-CH2-CH2-CH3
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
What is the chemical formula of ethyl ethanoic?
The structural formula is CH3COOCH2CH3
Ethyl butyrate structural formula?
H_ ..... _H H_C=C_H In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
What is the Structural formula of 3-chloro-2-methylpentane?
Ch3ch2ch(ch3)ch2ch=o
