0
What else can I help you with?
How many formula units are there in 0.0482 mol of sodium sulfate?
To determine the number of formula units in 0.0482 mol of sodium sulfate, you first need to find the molar mass of sodium sulfate (Na2SO4). The molar mass of Na2SO4 is approximately 142.04 g/mol. Then, divide the given amount of moles by the molar mass to find the number of formula units. In this case, there are approximately 3.39 x 10^22 formula units in 0.0482 mol of sodium sulfate.
How many moles of ammonium ions are in 8.903 g of ammonium carbonate?
The most common form of solid ammonium carbonate is a hydrate with formula (NH4)2CO3.H2O and a gram formula unit mass of 114.10. The formula shows that each formula unit contains 2 ammonium ions. The number of formula units of ammonium carbonate is 8.903/114.10 or 0.078028. The number of formula units of ammonium ions is twice this, or 0.1561, to the justified number of significant digits.
How many ammonium ions are present in 10.7g of ammonium phosphate?
The formula for the most common form of ammonium phosphate is (NH4)3PO4.3 H2O, and its gram formula mass is 203.13. The formula shows that there are 3 ammonium ions in each formula unit. 10.7g/203.13 is 5.27 X 10-2 formula units. Therefore, the number of ammonium ions present in 10.7g of this ammonium phosphate is 3 X 5.27 X 10-2 X Avogadro's Number or 9.52 X 1019 ammonium ions, to the justified number of significant digits.
How many formula units are in .671 moles of iron III sulfate?
One formula unit of iron III sulfate consists of one iron atom, three sulfur atoms, and 12 oxygen atoms. To calculate the number of formula units in 0.671 moles of iron III sulfate, you first need to determine the molar mass of the compound, then use the Avogadro's number (6.022 x 10^23) to convert moles to formula units.
How many atoms of aluminum sulfur and oxygen are in 3 molecules of aluminum sulfate?
1 formula unit of aluminum sulfate has the formula Al2(SO4)3. So there are 2 atoms of aluminum, 3 atoms of sulfur and 12 atoms of oxygen in 1 formula unit of aluminum sulfate. There are no molecules of aluminum sulfate. They are called formula units.
What is the chemical formula for Ammonium Laureth Sulfate?
The chemical formula for Ammonium Laureth Sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3NH4, where n is the number of ethylene oxide units.
How many formula units are in 5.38 moles of potassium sulfate?
The answer is 32,4.10e23.
How many formula units are there in 0.0482 mol of sodium sulfate?
To determine the number of formula units in 0.0482 mol of sodium sulfate, you first need to find the molar mass of sodium sulfate (Na2SO4). The molar mass of Na2SO4 is approximately 142.04 g/mol. Then, divide the given amount of moles by the molar mass to find the number of formula units. In this case, there are approximately 3.39 x 10^22 formula units in 0.0482 mol of sodium sulfate.
How many moles of ammonium ions are in 8.903 g of ammonium carbonate?
The most common form of solid ammonium carbonate is a hydrate with formula (NH4)2CO3.H2O and a gram formula unit mass of 114.10. The formula shows that each formula unit contains 2 ammonium ions. The number of formula units of ammonium carbonate is 8.903/114.10 or 0.078028. The number of formula units of ammonium ions is twice this, or 0.1561, to the justified number of significant digits.
What are the formula units for sodium sulfide sodium sulfite and sodium sulfate?
Sodium sulfide: Na2S Sodium sulfite: Na2SO3 Sodium sulfate: Na2SO4
Do All sulfate minerals have an SO4 in their chemical formula?
Yes, they have one or more SO4-2 units.
How many moles of formula units are in 5.67 g of iron III sulfate?
To find the moles of formula units in 5.67 g of iron III sulfate, you first need to calculate the molar mass of Fe2(SO4)3. The molar mass is 399.9 g/mol. Then, divide the given mass by the molar mass to find the number of moles. In this case, 5.67 g / 399.9 g/mol = 0.0142 moles of formula units.
How many ammonium ions are present in 10.7g of ammonium phosphate?
The formula for the most common form of ammonium phosphate is (NH4)3PO4.3 H2O, and its gram formula mass is 203.13. The formula shows that there are 3 ammonium ions in each formula unit. 10.7g/203.13 is 5.27 X 10-2 formula units. Therefore, the number of ammonium ions present in 10.7g of this ammonium phosphate is 3 X 5.27 X 10-2 X Avogadro's Number or 9.52 X 1019 ammonium ions, to the justified number of significant digits.
What is the mass of 43mol of sodium sulfate?
The gram formula mass of anhydrous sodium sulfate is 142.04. Therefore, 43 gram formula units* of it has a mass of 43(142.04)6.1 X 103 grams, to the justified number of significant digits. _____________________________ For ionic compounds such as sodium sulfate, the term "formula unit" is preferred to "mole".
How many formula units are in .671 moles of iron III sulfate?
One formula unit of iron III sulfate consists of one iron atom, three sulfur atoms, and 12 oxygen atoms. To calculate the number of formula units in 0.671 moles of iron III sulfate, you first need to determine the molar mass of the compound, then use the Avogadro's number (6.022 x 10^23) to convert moles to formula units.
How many atoms of aluminum sulfur and oxygen are in 3 molecules of aluminum sulfate?
1 formula unit of aluminum sulfate has the formula Al2(SO4)3. So there are 2 atoms of aluminum, 3 atoms of sulfur and 12 atoms of oxygen in 1 formula unit of aluminum sulfate. There are no molecules of aluminum sulfate. They are called formula units.
What is the number of formula units in 2.25 moles of ammonium chlorate?
Easy stuff. Take the number of moles given and multiply it by Avogadro's constant, which is 6.02x1023. That number represents the number of representative particles of any substance. So, 2.25 times that number gets you 13.55x1023, which you must adjust to 1.4x1024 formula units of ammonium chlorate (NH4ClO3).
