0
What else can I help you with?
What is the detergent soap bar formula?
Sodium Stearate , or Sodium Palmate. The formulas are Sodium stearate CH3(CH2)16COO^-Na^+ Sodium, palmate CH3(CH2)13COO^-Na^+ Soaps that lather (dissolve) in salt water have the sodium ion replace by a potassium ion (K^+). This is because of the common ion effect of sodium in sodium stereate and sadium in sodium chloride of salt water.
What is the structural formula for sodium stearate a type of soap?
The structural formula for sodium stearate, which is a type of soap, is CH3(CH2)16COONa. This formula represents the sodium salt of stearic acid, which is a long-chain fatty acid commonly found in soap formulations.
What is products of the saponification of NaOH?
Saponification is the hydrolysis of fat in presence of caustic soda (NaOH), the products are Soap and Glycerin CH2-CO-R1 CH2-OH R1-COONa | | CH-CO-R2 + 3NaOH --------> CH-OH + R2-COONa | | CH2-CO-R3 CH2-OH R3-COONa (Fat) (Glycerin) (Soap)
Which kind of industry does soap belong to?
The chemical industry. Soap manufacture is the boiling of sodium hydroxide with stearic acid. Here is the chemical eq'n CH3(CH2)16COOH + NaOH = CH3(CH2)16COO^-Na^+ (soap) + H2O ThaT IS THE BASIS OF SOAP MAKING. However, many modern soaps have perfumes, oils added etc., to soften the astringency of sodium stearate. Other soaps/detergents are wholly organic chemicals/enzzymes, so that they react without much heat.
What is a name for a familiar ionic compound?
Sodium chloride (NaCl) found in the home as TAble Salt. Also Sodium bi-carbonate (NaHCO3) as Baking #Poder. Sodium Carbonate (Na2CO3) as washing sode/ soda crystals. Sodium stearate ( NaOOC(CH2)16CH3) as soap.
How does soap react with the salts CaCl2 or MgCl2?
An insoluble salt is formed--commonly called soap scum. Soap is the potassium or sodium salt of fatty acids. When calcium takes the place of the sodium or potassium, a calcium salt is formed. This takes the form of a whitish precipitate.
What is the formula in sodium tallowate?
The formula of sodium tallowate, otherwise known as soap is CH3CH2....COONa. Sodium tollowate is a salt of a fatty acid.
What is the detergent soap bar formula?
Sodium Stearate , or Sodium Palmate. The formulas are Sodium stearate CH3(CH2)16COO^-Na^+ Sodium, palmate CH3(CH2)13COO^-Na^+ Soaps that lather (dissolve) in salt water have the sodium ion replace by a potassium ion (K^+). This is because of the common ion effect of sodium in sodium stereate and sadium in sodium chloride of salt water.
What is the structural formula for sodium stearate a type of soap?
The structural formula for sodium stearate, which is a type of soap, is CH3(CH2)16COONa. This formula represents the sodium salt of stearic acid, which is a long-chain fatty acid commonly found in soap formulations.
What is products of the saponification of NaOH?
Saponification is the hydrolysis of fat in presence of caustic soda (NaOH), the products are Soap and Glycerin CH2-CO-R1 CH2-OH R1-COONa | | CH-CO-R2 + 3NaOH --------> CH-OH + R2-COONa | | CH2-CO-R3 CH2-OH R3-COONa (Fat) (Glycerin) (Soap)
How soap detergent made of?
Soap was first made by boiling fat while adding some ingredients.Today, we've established that soap has a oxygen/hydrogen head and a hydrocarbonic tail.People've added dyes and perfumes in it too.Basic soap, with no additives, is made with fat and lye.
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
Which kind of industry does soap belong to?
The chemical industry. Soap manufacture is the boiling of sodium hydroxide with stearic acid. Here is the chemical eq'n CH3(CH2)16COOH + NaOH = CH3(CH2)16COO^-Na^+ (soap) + H2O ThaT IS THE BASIS OF SOAP MAKING. However, many modern soaps have perfumes, oils added etc., to soften the astringency of sodium stearate. Other soaps/detergents are wholly organic chemicals/enzzymes, so that they react without much heat.
Is Allicin water soluble?
Yes, I suppose so looking at the stable, quite ionic, polar (S-O) group in it:CH2=CHCH2-S+(-O-)-S-CH2CH=CH2
What is the formula for sodium laurate?
Sodium n-dodecanoate CH3-(CH2)10-C(=O)(-ONa)
How is 1-bromobutane reacts with sodium hydroxide?
1-bromobutane will undergo an SN2 reaction with sodium hydroxide to form 1-butanol and sodium bromide. In this reaction, the hydroxide ion replaces the bromine atom on the carbon chain, resulting in the formation of the alcohol product.
Equation of saponification using oleopalmitostearin as triglyceride?
CH2OCO(CH2)7CH=CH(CH2)7CH3 CH2OH CH3(CH2)7CH=CH(CH2)7COONa | | + CHOCO(CH12)12CH3 + 3NaOH ---> CHOH + CH3(CH2)14COONa | | + CH2OCO(CH2)16CH3 CH2OH CH3(CH2)16COONa
