0
Yes it is. Sodium oleate is formed.
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
Is benzoic acid is soluble in NaOH?
no, it is insoluble
Why is a dilute solution of oleic acid used instead of pure oleic acid?
The text is asking why a solution of oleic acid that has been weakened with water is used instead of pure oleic acid. Oleic acid is a type of fatty acid commonly found in animal and vegetable fats and oils. Diluting the solution may be necessary for certain applications to achieve a desired concentration or to prevent adverse effects.
What type of reaction is when dilute HCl is added to NaOH?
The reaction between HCl and NaOH is a neutralization reaction, or an acid/base reaction. It isHCl + NaOH ==> NaCl + H2O
Which chemicals produce only salt and water when reacted with dilute hydrochloric acid?
Sodium hydroxide (NaOH) react with dilute Hydrochloric Acid (HCl) to form Sodium chloride (NaCl) and water (H2O).
What salt is produced if sodium carbonate reacts with dilute nitric acid?
Dilute Nitric acid when reacted with Sodium hydroxide will produce Sodium nitrate and Water. NaOH + HNO3 = NaNO3 + H2O.
Is oleic acid soluble in sodium hydroxide?
Yes it is, oleic acid (18 carbon Chain carboxylic acid) will react with the Sodium Hydroxide (NaOH) and produce a new metal salt carboxylic acid.
Is oleic acid soluble in ethyl alcohol?
Yes
Is dilute acid soluble in water?
Dilute acid is already a solution.
Is benzoic acid is soluble in NaOH?
no, it is insoluble
Why is a dilute solution of oleic acid used instead of pure oleic acid?
The text is asking why a solution of oleic acid that has been weakened with water is used instead of pure oleic acid. Oleic acid is a type of fatty acid commonly found in animal and vegetable fats and oils. Diluting the solution may be necessary for certain applications to achieve a desired concentration or to prevent adverse effects.
Is sulfuric acid soluble NaOH?
Sulfuric acid reacts violently with NaOH, producing sodium sulfate and water and lots of heat!
What type of reaction is when dilute HCl is added to NaOH?
The reaction between HCl and NaOH is a neutralization reaction, or an acid/base reaction. It isHCl + NaOH ==> NaCl + H2O
How do you separate a mixture of oleic acid and solid potassium nitrate and powdered charcoal?
Potassium nitrate is soluble in water, the solution is filtered and evaporated.Oleic acid is soluble in ethanol and separated by filtration and evaporation of the alcohol.
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
Which chemicals produce only salt and water when reacted with dilute hydrochloric acid?
Sodium hydroxide (NaOH) react with dilute Hydrochloric Acid (HCl) to form Sodium chloride (NaCl) and water (H2O).
What salt is produced if sodium carbonate reacts with dilute nitric acid?
Dilute Nitric acid when reacted with Sodium hydroxide will produce Sodium nitrate and Water. NaOH + HNO3 = NaNO3 + H2O.
What would the simulation have shown if oleic acid was added to water?
Oleic acid is not miscible with water.
