0
What else can I help you with?
Is iron III oxide soluble in sodium hydroxide?
No, it is hardly soluble in sodium hydroxide though it is amphoteric. It's better in (hydrochloric) acid.
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
What salt is made when sodium hydroxide reacts with hydroxide acid?
There is no reaction. "Hydroxide acid" is water, which does not react with sodium hydroxide.
Why is it necessary to extract ether layer with sodium hydroxide when reacting benzoic acid with hydroxide ion?
It depends on the overall reaction. If the carboxylic acid is an impurity in the reaction (undesired), then washing with sodium hydroxide will extract the carboxylic into the aqueous layer, and it can then be disposed. The reaction for this looks as follows: (ring)-COOH + NaOH -> (ring)-COO-Na+ + H20 Where the ring loses a proton to the hydroxide ion and becomes water soluble.
What equation explains the solubility of p-chlorophenol in 15 percent sodium hydroxide?
The solubility of p-chlorophenol in 15% sodium hydroxide can be explained by the acid-base equilibrium reaction: p-chlorophenol (organic acid) + NaOH (base) -> sodium p-chlorophenate (soluble salt) The sodium hydroxide reacts with the p-chlorophenol to form a water-soluble salt, increasing its solubility in the solution.
Is oleic acid soluble dilute NaOH?
Yes, oleic acid is soluble in dilute NaOH due to the formation of soap through saponification reaction. Oleic acid reacts with NaOH to form the sodium salt of oleic acid, which is a soap that is water-soluble.
How do you saponify Oleic Acid?
Oleic acid can be saponified by reacting it with a strong base, such as sodium hydroxide or potassium hydroxide, in a process called saponification. This reaction results in the formation of the corresponding soap, which is the sodium or potassium salt of oleic acid, along with glycerol as a byproduct.
What is the balanced equation for fatty acid and sodium hydroxide?
The balanced equation for the reaction between a fatty acid (such as oleic acid) and sodium hydroxide is: Fatty acid + Sodium hydroxide -> Soap (sodium salt of the fatty acid) + Water
Does ethanoic acid soluble in water and sodium hydroxide?
Ethanoic acid is fully soluble in water, but it will react with sodium hydroxide.
Is ethanoic acid soluble in sodium hydroxide?
Yes, ethanoic acid (acetic acid) is soluble in sodium hydroxide. When acetic acid reacts with sodium hydroxide, it forms sodium acetate and water. Sodium acetate is a water-soluble salt, hence leading to the solubility of acetic acid in sodium hydroxide.
Is glacial acetic acid soluble in sodium hydroxide?
Glacial acetic acid reacts with sodium hydroxide to give sodium acetate and water CH3COOH + NaOH = CH3COONa + H2O
Is iron III oxide soluble in sodium hydroxide?
No, it is hardly soluble in sodium hydroxide though it is amphoteric. It's better in (hydrochloric) acid.
Is oleic acid soluble in chloroform?
Yes, oleic acid is soluble in chloroform due to its non-polar nature. Chloroform is a non-polar solvent, allowing for the dissolution of non-polar compounds like oleic acid.
Is salicylic acid soluble in 10 percent sodium hydroxide?
Salicylic acid is slightly soluble in 10 percent sodium hydroxide due to ionization of the carboxylic acid group, forming the salicylate ion. However, it is not highly soluble compared to other compounds due to its limited solubility.
Is oleic acid soluble in ethyl alcohol?
Yes
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
What is the the word equation for hydrochloric acid with sodium hydroxide?
Sodium hydroxide plus hydrochloric acid equals sodium chloride plus water.
