0
The compound CH3-CH-Cl-CH3 is 1-chlorobutane. It is a four-carbon alkane that contains one chlorine atom. It is a colorless liquid at room temperature and is slightly soluble in water. It is primarily used as a solvent in organic chemistry.
- Molecular Formula: C4H9Cl
- Molecular Weight: 92.57 g/mol
- Boiling Point: 104 C
- Melting Point: -90 C
- Density: 0.855 g/ml
What else can I help you with?
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the name of the compound CH3-CH2-CH2-CH2-CH2-F?
It is 1 fluoropentane.
What is ch3-ch2-nh-ch2-ch3?
diethylamine
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the name of the compound CH3-CH2-CH2-CH2-CH2-F?
It is 1 fluoropentane.
What is ch3-ch2-nh-ch2-ch3?
diethylamine
What is h3c-c-ch2-ch3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
What is the nomenclature for ch3-ch2-ch2-ch2-ch2-ch2-ch2-cho?
The compound CH3-CH2-CH2-CH2-CH2-CH2-CHO is an aldehyde with a straight-chain structure. It consists of a seven-carbon chain (heptanal) with an aldehyde functional group (-CHO) at one end. Therefore, the correct IUPAC name for this compound is heptanal.
What is CH3-CH2-CH2-F CH3?
The compound CH3-CH2-CH2-F is 1-fluoropropane, a halogenated derivative of propane. It is a colorless gas commonly used as a refrigerant. The CH3 after F represents another methyl group attached to the carbon chain.
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
