it doesnt contain the number at the beginning showing where do the double bond is located.
The product of the hydrogenation of 3,6,6-trimethyl-4-nonene is 3,6,6-trimethyl-4-nonane.
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
C9H16 is the chemical formula for cyclohexene, which is a cyclic hydrocarbon commonly used as a solvent and in the production of plastics and synthetic chemicals.
2-ethylpropane is incorrect because the name does not follow the IUPAC rules for naming organic compounds. The correct name for the compound with the formula C7H16 would be 2-methylheptane.
The product of the hydrogenation of 3,6,6-trimethyl-4-nonene is 3,6,6-trimethyl-4-nonane.
1-nonene is an alkene, as it contains a carbon-carbon double bond.
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
1-nonene is an alkene because it has a double bond between two carbon atoms in its carbon chain.
The chemical compound C9H16 is known as nonene. It is an alkene with nine carbon atoms and sixteen hydrogen atoms in its molecular structure. Nonene is commonly used in the production of plastics and as a starting material for various chemical reactions.
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
If you just joined, then it will be incorrect. I don't know why it is like that, but you original name will come soon.
MISNOMER
A false name or an incorrect or wrong name
C9H16 is the chemical formula for cyclohexene, which is a cyclic hydrocarbon commonly used as a solvent and in the production of plastics and synthetic chemicals.
Why can't I send or get mail on my I PAD. It is saying that my user name or password is incorrect!
Incorrect name; methane ?