0
What else can I help you with?
What is the name of the product of the hydrogenation of 366-trimethyl-4-nonene?
The product of the hydrogenation of 3,6,6-trimethyl-4-nonene is 3,6,6-trimethyl-4-nonane.
What is the chemical and structural formula of 4-nonene?
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
What is the structure of 4-methyl-4-nonene?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is C9H16?
C9H16 is the chemical formula for cyclohexene, which is a cyclic hydrocarbon commonly used as a solvent and in the production of plastics and synthetic chemicals.
Why is 2-ethylpropane incorrect?
2-ethylpropane is incorrect because the name does not follow the IUPAC rules for naming organic compounds. The correct name for the compound with the formula C7H16 would be 2-methylheptane.
What is the name of the product of the hydrogenation of 366-trimethyl-4-nonene?
The product of the hydrogenation of 3,6,6-trimethyl-4-nonene is 3,6,6-trimethyl-4-nonane.
Is 1-nonene an alkane alkene or an alcohol?
1-nonene is an alkene, as it contains a carbon-carbon double bond.
What is the chemical and structural formula of 4-nonene?
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
Is 1 nonene alkane alkene or alcohol?
1-nonene is an alkene because it has a double bond between two carbon atoms in its carbon chain.
What chemical compound is C9 H16?
The chemical compound C9H16 is known as nonene. It is an alkene with nine carbon atoms and sixteen hydrogen atoms in its molecular structure. Nonene is commonly used in the production of plastics and as a starting material for various chemical reactions.
What is the structure of 4-methyl-4-nonene?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
Why is your name incorrect on Club Penguin?
If you just joined, then it will be incorrect. I don't know why it is like that, but you original name will come soon.
What is an incorrect or unsuitable name?
MISNOMER
What does misnomer mean?
A false name or an incorrect or wrong name
What is C9H16?
C9H16 is the chemical formula for cyclohexene, which is a cyclic hydrocarbon commonly used as a solvent and in the production of plastics and synthetic chemicals.
Why can't I send or get mail on my IPAD. It is saying that my user name or password is incorrect.?
Why can't I send or get mail on my I PAD. It is saying that my user name or password is incorrect!
What is the chemical property of mthaine?
Incorrect name; methane ?
