0
it doesnt contain the number at the beginning showing where do the double bond is located.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What is the name of the product of the hydrogenation of 366-trimethyl-4-nonene?
3,6,6-trimethylnonane.
What is C9H16?
nonene
What is the chemical and structural formula of 4-nonene?
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
What is the structure of 4-methyl-4-nonene?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is incorrect about the name monosulfur dioxide for the compound SO3?
There are 3 oxygens so it should be trioxide and not dioxide.
What is the name of the product of the hydrogenation of 366-trimethyl-4-nonene?
3,6,6-trimethylnonane.
What is C9H16?
nonene
Is 1-nonene an alkane alkene or an alcohol?
alkene
Is 1 nonene alkane alkene or alcohol?
Alkene
What is the chemical and structural formula of 4-nonene?
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
What is the structure of 4-methyl-4-nonene?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
Why is your name incorrect on Club Penguin?
If you just joined, then it will be incorrect. I don't know why it is like that, but you original name will come soon.
What is the Molecular formula for 2-butyne?
What is the molecular formula of 2-Butyne
What is an incorrect or unsuitable name?
MISNOMER
What does misnomer mean?
A false name or an incorrect or wrong name
Why can't I send or get mail on my IPAD. It is saying that my user name or password is incorrect.?
Why can't I send or get mail on my I PAD. It is saying that my user name or password is incorrect!
What is the chemical property of mthaine?
Incorrect name; methane ?
