0
What else can I help you with?
What is the balanced equation for the reaction of oleic acid and iodine?
The balanced equation for the reaction of oleic acid (C18H34O2) and iodine (I2) is: C18H34O2 + 6I2 → C18H33I6O2 + 6HI. This equation shows that one molecule of oleic acid reacts with six molecules of iodine to form one molecule of iodine-substituted oleic acid and six molecules of hydrogen iodide. Balancing the equation ensures that the number of atoms of each element is the same on both sides of the reaction.
What is the equation of the reaction between oleic acid and potassium permanganate?
The equation for the reaction between oleic acid and potassium permanganate is not straightforward because it depends on the conditions and concentrations. Generally, potassium permanganate can oxidize oleic acid to form carbon dioxide and water along with other byproducts. The balanced equation will depend on the stoichiometry of the reaction and the specific conditions.
What is the reaction of iodine and oleic acid?
When iodine reacts with oleic acid, it forms iodine addition products. These products result from the addition of iodine across the C=C double bonds present in oleic acid. The reaction typically involves the formation of di-iodo derivatives of oleic acid.
What is the balanced equation for fatty acid and sodium hydroxide?
The balanced equation for the reaction between a fatty acid (such as oleic acid) and sodium hydroxide is: Fatty acid + Sodium hydroxide -> Soap (sodium salt of the fatty acid) + Water
Is oleic acid soluble dilute NaOH?
Yes, oleic acid is soluble in dilute NaOH due to the formation of soap through saponification reaction. Oleic acid reacts with NaOH to form the sodium salt of oleic acid, which is a soap that is water-soluble.
What is the balanced equation for the reaction of oleic acid and iodine?
The balanced equation for the reaction of oleic acid (C18H34O2) and iodine (I2) is: C18H34O2 + 6I2 → C18H33I6O2 + 6HI. This equation shows that one molecule of oleic acid reacts with six molecules of iodine to form one molecule of iodine-substituted oleic acid and six molecules of hydrogen iodide. Balancing the equation ensures that the number of atoms of each element is the same on both sides of the reaction.
What is the equation of the reaction between oleic acid and potassium permanganate?
The equation for the reaction between oleic acid and potassium permanganate is not straightforward because it depends on the conditions and concentrations. Generally, potassium permanganate can oxidize oleic acid to form carbon dioxide and water along with other byproducts. The balanced equation will depend on the stoichiometry of the reaction and the specific conditions.
What is the chemical formula of oleic acid?
C18H34O2
What is the reaction of iodine and oleic acid?
When iodine reacts with oleic acid, it forms iodine addition products. These products result from the addition of iodine across the C=C double bonds present in oleic acid. The reaction typically involves the formation of di-iodo derivatives of oleic acid.
What is the balanced equation for fatty acid and sodium hydroxide?
The balanced equation for the reaction between a fatty acid (such as oleic acid) and sodium hydroxide is: Fatty acid + Sodium hydroxide -> Soap (sodium salt of the fatty acid) + Water
What is the formula of oleic acid?
The formula of olecic acid is C17H33COOH. It is an unsaturated fatty acid
The chemical formula for oleum is?
Formula: H2S2O7
Is oleic acid a compound?
Oleic Acid is a Chemical Compound. It is an unsaturated fatty acid that is the most widely distributed and abundant fatty acid in nature.
Is oleic acid soluble dilute NaOH?
Yes, oleic acid is soluble in dilute NaOH due to the formation of soap through saponification reaction. Oleic acid reacts with NaOH to form the sodium salt of oleic acid, which is a soap that is water-soluble.
Oleic acid is a fat found in olive oil It has the chemical formula C18H34O2 What is the molecular mass of oleic acid Please choose the correct unit for your answer?
The molecular mass of oleic acid is 282.46 grams per mole.
How do you saponify Oleic Acid?
Oleic acid can be saponified by reacting it with a strong base, such as sodium hydroxide or potassium hydroxide, in a process called saponification. This reaction results in the formation of the corresponding soap, which is the sodium or potassium salt of oleic acid, along with glycerol as a byproduct.
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
