0
What else can I help you with?
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is the IUPAC name of CH3-CHNH2-CH2-OH?
The IUPAC name of CH3-CHNH2-CH2-OH is 2-aminoethanol.
What is the iupac name for ch3 - ch2 - ch2 - sh?
Propan-1-thiol. NB When writing chemical formulae , single letter elements are ALWAYS written as a CAPITAL letter. Hence ; CH3- CH2- CH2-SH This is tha international IUPAC standard.
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is the IUPAC name of CH3-CHNH2-CH2-OH?
The IUPAC name of CH3-CHNH2-CH2-OH is 2-aminoethanol.
What is the iupac name for ch3 - ch2 - ch2 - sh?
Propan-1-thiol. NB When writing chemical formulae , single letter elements are ALWAYS written as a CAPITAL letter. Hence ; CH3- CH2- CH2-SH This is tha international IUPAC standard.
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?
oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches
What is the iupac name for ch2 ch2 ch2 ch2 ch2 ch2 ch2?
CH2CH2CH2CH2CH2CH2CH2 is an impossible compound formula.CH3CH2CH2CH2CH2CH2CH3 however is called n-heptane (with CH3 at both endings)
What is the iupac name for ch3 ch2 ch3?
The IUPAC name for CH3CH2CH3 is propane. It is a three-carbon alkane with the chemical formula C3H8.
