answersLogoWhite

0

propanal

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

What is the IUPAC name for CH3-CH2-CH2-CH2-Br?

1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.


What is the iupac name for ch3 ch2 ch2 o ch3?

propyl-methyl ether


What is the iupac name for ch3-ch2-ch2-oh?

Pentanol


What is the IUPAC name for CH2 equals CH-O-CH3?

The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.


What is the IUPAC name of CH3-CHNH2-CH2-OH?

The IUPAC name of CH3-CHNH2-CH2-OH is 2-aminoethanol.


What is the iupac name for ch3 - ch2 - ch2 - sh?

Propan-1-thiol. NB When writing chemical formulae , single letter elements are ALWAYS written as a CAPITAL letter. Hence ; CH3- CH2- CH2-SH This is tha international IUPAC standard.


What is the IUPAC name for ch3-ch equals ch-ch3?

The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.


What is the IUPAC name of CH33C2?

(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane


What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?

The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.


What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?

oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches


What is the iupac name for ch2 ch2 ch2 ch2 ch2 ch2 ch2?

CH2CH2CH2CH2CH2CH2CH2 is an impossible compound formula.CH3CH2CH2CH2CH2CH2CH3 however is called n-heptane (with CH3 at both endings)


What is the iupac name for ch3 ch2 ch3?

The IUPAC name for CH3CH2CH3 is propane. It is a three-carbon alkane with the chemical formula C3H8.