0
CH2CH2CH2CH2CH2CH2CH2 is an impossible compound formula.
CH3CH2CH2CH2CH2CH2CH3 however is called n-heptane (with CH3 at both endings)
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What is the name of the compound CH3 CH2 Br?
I would call it something like 2-bromo propanoic acid
What ester does butyric acid and amyl alcohol form?
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
What is iupac name of tatric acid?
The IUPAC name for tartaric acid is 2,3-dihydroxybutanedioic acid.
What is the IUPAC name for C4H7Cl?
The IUPAC name for C4H7Cl is (E)-1-chlorobut-2-ene.
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
Butane
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is the iupac name for ch3 - ch2 - ch2 - sh?
It is propan-1- thiol
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3 ch2 ch3?
Propane
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?
oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches
What is the IUPAC name for CH2 equals CH-O-CH3?
CH2CHOCH3 is methoxyethene.
What is the IUPAC name of CH3-CHNH2-CH2-OH?
It's name is 2-amino-propanol.
Iupac name of ch3 - ch2 - O - ch2 - ch3?
Ethoxyethane Ethyl = 2 carbons ethane + oxygen + ethane = ethoxyethane
What is the iupaC for CH3 CH2 COH?
propanal
What is the name for ch3-ch2-ch2-ch2-ch2-nh2?
IUPAC name: 1-aminopropane Common name: n-Propylamine This is a primary amine - since the N is only bonded to one C in the CH2 group. To come up with IUPAC name, you name it as you would an alkane. This has a three carbon chain which makes it propane. You add the amino in front of propane. The 1 indicates what carbon the NH2 is bonded to. To come up with common name, you name the alkyl group, followed by the word amine. So, CH3, CH2, CH2 is propyl - add an amine at end. Propylamine is correct, but n-propylamine is more correct.
