0
What else can I help you with?
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the iupac name for ch2 ch2 ch2 ch2 ch2 ch2 ch2?
CH2CH2CH2CH2CH2CH2CH2 is an impossible compound formula.CH3CH2CH2CH2CH2CH2CH3 however is called n-heptane (with CH3 at both endings)
What is the nomenclature for ch3-ch2-ch2-ch2-ch2-ch2-ch2-cho?
The compound CH3-CH2-CH2-CH2-CH2-CH2-CHO is an aldehyde with a straight-chain structure. It consists of a seven-carbon chain (heptanal) with an aldehyde functional group (-CHO) at one end. Therefore, the correct IUPAC name for this compound is heptanal.
What is CH2 chemical formula with molar mass?
C2H6 is a gas (in chemistry), similar to methane, propane, and butane. I'm not sure what the name of this gas is, but it ends in -ane. Sure of that.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the iupac name for ch2 ch2 ch2 ch2 ch2 ch2 ch2?
CH2CH2CH2CH2CH2CH2CH2 is an impossible compound formula.CH3CH2CH2CH2CH2CH2CH3 however is called n-heptane (with CH3 at both endings)
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name of the compound CH3-CH2-CH2-CH2-CH2-F?
It is 1 fluoropentane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is the nomenclature for ch3-ch2-ch2-ch2-ch2-ch2-ch2-cho?
The compound CH3-CH2-CH2-CH2-CH2-CH2-CHO is an aldehyde with a straight-chain structure. It consists of a seven-carbon chain (heptanal) with an aldehyde functional group (-CHO) at one end. Therefore, the correct IUPAC name for this compound is heptanal.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
What is the name for ch3-ch2-ch2-ch2-o-c6h5?
It is 1-butoxy benzene
What is CH2 chemical formula with molar mass?
C2H6 is a gas (in chemistry), similar to methane, propane, and butane. I'm not sure what the name of this gas is, but it ends in -ane. Sure of that.
What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?
oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches
