0
Assuming you meant to write it: CH3CH2CH2COONa
The IUPAC name is Sodium Butanoate.
It is a sodium salt of a carboxylic acid - sodium is there because of, well, the sodium cation, and four carbons mean a but- prefix so the anion is called butanoate. The -anoate is just something that the people at IUPAC like to confuse us with, it's just the naming system for this kind of salt and you just gotta learn it.
It can also be shown CH3CH2CH2COO-Na+ since there is an ionic bond between the ethanoate ion and sodium ion.
NB. If you put the 2 in front of the CH, that means that the CH is a branch off the parent chain... but since I couldn't find a way to arrange it that way which satisfies the valency of carbon, I assumed it was meant to be after the CH. Is this right?
What else can I help you with?
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is the IUPAC name of CH3-CHNH2-CH2-OH?
The IUPAC name of CH3-CHNH2-CH2-OH is 2-aminoethanol.
What is the iupac name for ch3 - ch2 - ch2 - sh?
Propan-1-thiol. NB When writing chemical formulae , single letter elements are ALWAYS written as a CAPITAL letter. Hence ; CH3- CH2- CH2-SH This is tha international IUPAC standard.
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the iupac name for ch3-ch2-ch2-oh?
Pentanol
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is the IUPAC name of CH3-CHNH2-CH2-OH?
The IUPAC name of CH3-CHNH2-CH2-OH is 2-aminoethanol.
What is the iupac name for ch3 - ch2 - ch2 - sh?
Propan-1-thiol. NB When writing chemical formulae , single letter elements are ALWAYS written as a CAPITAL letter. Hence ; CH3- CH2- CH2-SH This is tha international IUPAC standard.
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
What is the iupac name for ch3 ch2 ch3?
The IUPAC name for CH3CH2CH3 is propane. It is a three-carbon alkane with the chemical formula C3H8.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the iupaC for CH3 CH2 COH?
The IUPAC name for CH3CH2COH is propan-1-ol.
What is the IUPAC name of CH33C2?
(CH3-CH2)3-C-CH2-CH2-CH2-CH2-C-(CH3)3 It is 7,7-diethyl-2,2-dimethylnonane
What is the iupac name for ch2 ch2 ch2 ch2 ch2 ch2 ch2?
CH2CH2CH2CH2CH2CH2CH2 is an impossible compound formula.CH3CH2CH2CH2CH2CH2CH3 however is called n-heptane (with CH3 at both endings)
