answersLogoWhite

0

I would think tetrahedral.But I am rusty, so it could be trigonal pyramidal.

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

What is the molecular shape of CH3?

Trigonal planar.


What is the molecular geometry of CH3 plus?

Trigonal Planar


What is the shape bond angle and hybridization of plus CH3?

CH3 is a trigonal planar and has a hybridization of sp3


What is the molecular formula of CTAB?

[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide


What is the molecular formula of the Methyl Group?

The molecular formula of the methyl group is CH3. It consists of one carbon atom bonded to three hydrogen atoms.


What is the molecular structure of acetic acid?

CH3-COOH


What is the molecular structure of 3-methylpentane?

ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3


What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?

What is mol mass of CH3(CH2)11(OCH2CH2)nOSO3Na


What is C2H5OH molecular shape?

The molecular shape of this molecule is made up of two distinct shapes. In CH3-ch2-ch3 the shapes of the first and third carbons is trigonal planar; that of the second carbon is tetrahedral.


How much isomers does c5h10 have?

yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT


What is the secondary amine with the molecular formula C3H9N?

The secondary amine with the molecular formula C3H9N is dimethylamine. It has the chemical structure CH3-NH-CH3, with two methyl groups attached to the nitrogen atom.


Is Al plus 3Hg(CH3)2 yields Al(CH3)3 plus 3Hg a precipitation reaction?

Trimethyl aluminium is not a solid precipitate.