0
I would think tetrahedral.But I am rusty, so it could be trigonal pyramidal.
Wiki User
∙ 13y ago
Wiki User
∙ 10y agoTrigonal planar.
Add your answer:
Earn +20 pts
What is C2H5OH molecular shape?
The molecular shape of this molecule is made up of two distinct shapes. In CH3-ch2-ch3 the shapes of the first and third carbons is trigonal planar; that of the second carbon is tetrahedral.
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
Is n-Butanol an ionic or molecular compound?
Molecular, specifically an organic compound with the general formula: CH3(CH2)3OH
What is the molecular shape of the OSbCl3 ion when Sb is the central atom?
The OsbCl3 ion has a tetrahedral molecular shape
What would be the spatial arrangement (shape) of the atoms of the methyl anion CH3-?
tetra
What is the molecular shape of CH3?
Trigonal planar.
What is the molecular geometry of CH3 plus?
Trigonal Planar
What is the shape bond angle and hybridization of plus CH3?
CH3 is a trigonal planar and has a hybridization of sp3
What is the molecular formula of the Methyl Group?
-CH3
What is C2H5OH molecular shape?
The molecular shape of this molecule is made up of two distinct shapes. In CH3-ch2-ch3 the shapes of the first and third carbons is trigonal planar; that of the second carbon is tetrahedral.
What is the molecular formula of CTAB?
[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide
What is the molecular structure of acetic acid?
CH3-COOH
How much isomers does c5h10 have?
yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT
What is the molecular structure of 3-methylpentane?
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
What is mol mass of CH3(CH2)11(OCH2CH2)nOSO3Na
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
Is n-Butanol an ionic or molecular compound?
Molecular, specifically an organic compound with the general formula: CH3(CH2)3OH
