0
cations and anions
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What type of bond will form between Na and I?
Na and S will form an ionic bond because Na is a nonmetal and S is a metal. Therefore when a metal and nonmetal bond, it forms an ionic bond.
What is NaC1 an example of?
Sodium chloride or NaCl is a salt that is an example of an ionic compound. Ionic compounds are compounds that exhibit ionic bonding between sodium ions called cations and chloride ions called anions.
What type of compound ionic or covalent will conduct electricity and dissolve in water?
Ionic compounds generally dissolve in water dissociating to give ions that are free to move and conduct electricity. Molten ionic compounds also have free ions and conduct electricity. Ionic compounds generally do not conduct electricity in the solid form.
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
What type of reaction forms when a metal and nonmetal element form an ionic compound?
Electron(s) are tansferred tpo form a metal cation (positive charge) and a non-metal anion (negative charge). The ions combine to form a crystal lattice.
What type of compound can oxygen and sodium form?
Ionic, Na2O with Na+ ions and O2- ions Also forms a peroxide Na2O2 with Na+ and O22-
What is an ionic Comound?
An ionic compound is a chemical compound in which ions are held together in a lattice structure by ionic bounds. Ionic bonds is a type of chemical bond that can often form between metal and non-metal ions (or polyatomic ions such as ammonium.) through electrostatic attraction. In short, it is a bond formed by the attraction between two oppositely charged ions.
What type of bond do oppositely charged ions form?
Oppositely charged ions form ionic bonds.
What type of bond will form between Na and I?
Na and S will form an ionic bond because Na is a nonmetal and S is a metal. Therefore when a metal and nonmetal bond, it forms an ionic bond.
When charged ions unite do they form molecules?
No, they do not. When charged atoms, or ions, unite in an ionic bond, they form what is called a "formula unit," which is the smallest representative particle of an ionic compound. A molecule is the smallest representative particle of a covalent compound, which involves another type of bonding where electrons are shared rather than transferred.
What is NaC1 an example of?
Sodium chloride or NaCl is a salt that is an example of an ionic compound. Ionic compounds are compounds that exhibit ionic bonding between sodium ions called cations and chloride ions called anions.
What type of compound ionic or covalent will conduct electricity and dissolve in water?
Ionic compounds generally dissolve in water dissociating to give ions that are free to move and conduct electricity. Molten ionic compounds also have free ions and conduct electricity. Ionic compounds generally do not conduct electricity in the solid form.
When a metal and a non metal element combine they form what type of compound ionic or molecular?
A metal and a non-metal bond to form an ionic compound.
Can methane separate easily into ions?
No, methane does not tend to ionize and it is not an ionic compound, it is a covalent type of molecule.
What type of compound do most nonmetals form?
ionic compounds
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
What type of element forms the negative ion in an ionic compound?
Elements from the Right Hand Side of the periodic table especially from the halogens and the oxygen groups form negative ions in ionic compounds.
