0
What else can I help you with?
What is the molecular formula of a compound with an empirical formula of CH?
The molecular formula of a compound with an empirical formula of CH is likely to be CH, as there is only one carbon atom and one hydrogen atom in the empirical formula. In this case, the empirical formula is also the molecular formula.
What is the empirical formula for C8H10?
The empirical formula for C8H10 is CH5. This is found by dividing the subscripts in the molecular formula by their greatest common factor.
What two compounds have the same empirical formula?
CH4 has the same molecular and empirical formulas.
What is the chemical formula of polyvinyl acetate?
{CH2- CH-OOC-CH3}N where N is very large and often over 200,000 CH2=CH-OOC-CH3 is the formual for vinyl acetate monomer. The double bond opens up and polymerizes giving the structure above with only a single bond between the CH2 and the CH.
What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?
The condensed structural formula for 3-ethyl-2,5-dimethyloctane is CH3CH(CH2CH3)CH(CH3)C(CH3)2CH2CH2CH3.
What the empirical formula for c12h12?
CH will be the empirical formula and C12H12 will be the molecular formula
Empirical formula of benzene?
Ch
What is the molecular formula of a compound with an empirical formula of CH?
The molecular formula of a compound with an empirical formula of CH is likely to be CH, as there is only one carbon atom and one hydrogen atom in the empirical formula. In this case, the empirical formula is also the molecular formula.
What is an empirical formula c4h8 c2h4 ch c2h2?
CH2 is the empirical formula for C4H8 because it is an alkene and the empirical fomula for ALL alkenes are C(n)H(2n) n being the number of molecules!!! (^-^)
What are the molecular formula and the empirical formula for benzene?
The molecular formula for benzene is C6H6, and the empirical formula is also C6H6. The empirical formula represents the simplest whole-number ratio of atoms in a compound, while the molecular formula gives the actual number of each type of atom in a molecule.
What is the empirical formula of dimethylhydrazine?
C2H8N2 is molecular formula so empirical formula is C1H4N1
What would be the empirical formula of octane?
the structural formula for octane(straight chain) is CH3 CH2 CH2 CH2 CH2 CH2 CH2 CH3
The empirical formula for acetylene?
Acetylene is C2H2 so its emperical formula is C1H1.
What is the empirical formula for C8H10?
The empirical formula for C8H10 is CH5. This is found by dividing the subscripts in the molecular formula by their greatest common factor.
Styrofoam is a trade name for polystyrene foam Styrene has an empirical formula of CH It has a molecular mass of 104 amu What is the correct molecular formula for styrene?
The molecular formula for styrene is C8H8. This is derived by multiplying the empirical formula (CH) by a factor of 8 to get the molecular formula. Styrene consists of 8 carbon atoms and 8 hydrogen atoms.
Styrene has the empirical formula CH. It has a molar mass of 104 g. What is the multiplier to get the molecular formula?
The molar mass of styrene (C8H8) is 104 g/mol. The empirical formula is CH, which has a molar mass of 13 g/mol. To find the multiplier to get the molecular formula from the empirical formula, divide the molar mass of the molecular formula by the molar mass of the empirical formula: 104 g/mol / 13 g/mol = 8. This means the multiplier is 8, and the molecular formula of styrene is C8H8.
What is the empirical formula for C9H20?
The empirical formula for C9H20 is C3H7. This is because we divide the subscripts by their greatest common factor, which in this case is 3.
