0
You find the weights of each element in the compound and divide by their relative Atomic Mass to find out the moles. You find the simplest ratio of the mole values you have found and then you can find the percentages using this ratio
Add your answer:
Earn +20 pts
What is the percent composition of aluminum sulfate?
the percentage composition of aluminum sulfate is 342
What is the percent of water in calcium sulfate?
the % hydrate of calcium sulfate is 20.9%
Aluminum sulfate plus calcium hydroxide equals aluminum hydroxide plus calcium sulfate?
Yes, if sufficiently concentrated solutions in water of calcium hydroxide and aluminum sulfate are mixed, calcium sulfate will precipitate.
Is calcium sulfate compound?
Calcium Sulfate is a metal salt that is a product of acid + metal carbonate; in this case: Sulfuric acid + Calcium Carbonate = calcium sulfate. The formulae for this is CaSO4.
What is the chemical formula for calcium sulfate aq?
The chemical formula for Calcium Sulfate is CaSO4
What is the percent composition of aluminum sulfate?
the percentage composition of aluminum sulfate is 342
What is the percentage composition of amonium sulfate?
The percentage composition of amonium sulfate is:- Nitrogen: 21,21 %- Hydrogen: 6,06 %- Sulfur: 24,24 %- Oxygen: 48,48 %
What is the composition of Plaster of Paris?
Plaster of Paris is essentially calcium sulfate (CaSO4) with a little water attached.
What is the percent composition of water in copper II sulfate pentahydrate?
The percentage of water in copper(II) sulfate pentahydrate is 36,04 %.
How do you calculate the percent composition of sodium laureth sulfate?
The chemical formula of sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na; if you know the value of n and the atomic weights of the elements you can calculate the percent composition.
What is the calcium sulfate?
The chemical formula of calcium sulfate is CaSO4.
Is calcium sulfate an element?
No, because it has 2 substances in it - calcium and sulfate - Calcium is an element, but sulfate is a polyatomic ion. Sulfate consists of sulfur and oxygen. Therefore, calcium sulfate is a compound, that is, made of three elements.
Is calcium sulfate organic or inorganic?
Calcium sulfate is an inorganic compound.
What is the percent of water in calcium sulfate?
the % hydrate of calcium sulfate is 20.9%
When solutions of magnesium sulfate and calcium chloride are mixed calcium sulfate precipitates?
Yes, because calcium sulfate is insoluble in water.
How many calcium's are in calcium sulfate?
Calcium Sulfate has one calcium, because calcium is positively charged (2+) and sulfate is negatively charged (2-) and combines together 1 to 1 to form neutral calcium sulfate, or: Ca2+ + SO42- → CaSO4
Is calcium sulfate a element compound or mixture?
Calcium sulfate (CaSO4) is a compound.
