0
well i think it doesn't even like exist so yeah teachers who give this question are stupid> What!!!!!!!!!!!! wtf!!!!!!!!! i already answered it u stupid old guy.
Wiki User
∙ 16y ago
Add your answer:
Earn +20 pts
How many sodium atoms are in hydrogen?
None. Hydrogen is an element. It contains only hydrogen atoms.
How many hydrogen atoms in Ammonium Hydroxide?
Five(5) hydrogen atoms
How many atoms of carbon and hydrogen does decane have in it?
Decane has 10 carbon atoms and 22 hydrogen atoms.
How many hydrogen atoms does cyclohexane have?
Since the chemical formula for Cycohexane is C6H12, it has 12 atoms of Hydrogen.
How many atoms of hydrogen are in are in sugar?
I know that table salt has no hydrogen atoms; NaCl2
How many hydrogen atoms would be needed to complete the following structure CC-O-C?
Eight hydrogen atoms are necessary (ethyl methyl ether).
How many hydrogen atoms are present in 3-methyl-4-propyl-3-octene?
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
What is Methyl acetate made of?
Carbon, hydrogen, and oxygen atoms; the molecular formula of methyl acetate is C3H6O2.
Does methyl group consists of a carbon bonded to three hydrogen atoms?
Yes, a methyl group consists of three hydrogen atoms bonded to a carbon atom, with a univalent radical. Add one hydrogen atom and you have methane.
What groups consists of carbon and hydrogen atoms and can control whether genes make proteins or remain silent?
Methyl groups
How many proton nmr signals would you expect for ch3 ch2 ch3?
Two: One from the six hydrogen atoms that are part of methyl groups and a second from the two hydrogen atoms that are attached to the central carbon atom.
What is another word for methyl?
Methyl is derived from methane. It is one carbon atom which is bonded to three hydrogen atoms. The methyl group comes in 3 forms: anion; cation or radical.
What is a functional group which contains 1 Carbon atom 3 Hydrogen atoms?
The group -CH3 is named methyl.
How many hydrogen atoms are present in 1 mole of acetic acid or CH3COOH?
CH3COOH CH3COO- + H+So there is only one acidic H atom.[Only the 'bold' H atom is acidic, the 3 'methyl' H's are not!]
How many hydrogen atoms does caffeine has?
To answer your question on how many hydrogen atoms are there in caffeine, the scientific answer would be 10 atoms of hydrogen.
How many atoms does the hydrogen have?
Three-quarters of the Sun's mass is hydrogen. How many hydrogen atoms are in the Sun?
How many atoms of hydrogen are in 3.4 grams of hydrogen peroxide?
1,204428358.1023 atoms of hydrogen
