well i think it doesn't even like exist so yeah teachers who give this question are stupid> What!!!!!!!!!!!! wtf!!!!!!!!! i already answered it u stupid old guy.
The molecular formula of the methyl group is CH3. It consists of one carbon atom bonded to three hydrogen atoms.
You just need to count them. The first part of the formula (CH3) tells us that there are 3 hydrogen atoms present. In the second part of the formula, there is a fourth hydrogen atom. Therefore, one molecule has 4 hydrogen atoms.
Decane has 10 carbon atoms and 22 hydrogen atoms.
There are 4 hydrogen atoms in ammonium hydroxide (NH4OH).
I know that table salt has no hydrogen atoms; NaCl2
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
In 2,5-dimethyloctane, there are 22 hydrogen atoms. Each methyl (CH3) group has 3 hydrogen atoms, so for two methyl groups, it would be 2 x 3 = 6 hydrogen atoms. Octane has 16 hydrogen atoms. Therefore, 6 + 16 = 22 hydrogen atoms in total for 2,5-dimethyloctane.
Yes, a methyl group consists of three hydrogen atoms bonded to a carbon atom, with a univalent radical. Add one hydrogen atom and you have methane.
Eight hydrogen atoms are necessary (ethyl methyl ether).
The methyl skeletal structure of a compound refers to the arrangement of carbon and hydrogen atoms in the molecule. It shows how the carbon atoms are connected to each other and to the hydrogen atoms.
Carbon, hydrogen, and oxygen atoms; the molecular formula of methyl acetate is C3H6O2.
There are five hydrogen atoms in 1-methylcyclopropane. Each carbon atom in the cyclopropane ring is bonded to one hydrogen atom, and the methyl group attached to one of the carbons adds three more hydrogen atoms.
Methyl fluoride (CH3F) has three bonding pairs of electrons between carbon and hydrogen atoms in the methyl group, and one bonding pair of electrons between carbon and fluorine atoms. Therefore, there are a total of four bonding pairs of electrons in methyl fluoride.
Methyl groups
The functional group that contains 1 carbon atom and 3 hydrogen atoms is a methyl group, denoted as -CH3. This group consists of a carbon atom bonded to three hydrogen atoms. It is commonly found in organic compounds.
Methyl is derived from methane. It is one carbon atom which is bonded to three hydrogen atoms. The methyl group comes in 3 forms: anion; cation or radical.
The molecular formula of the methyl group is CH3. It consists of one carbon atom bonded to three hydrogen atoms.