answersLogoWhite

0

well i think it doesn't even like exist so yeah teachers who give this question are stupid> What!!!!!!!!!!!! wtf!!!!!!!!! i already answered it u stupid old guy.

User Avatar

Wiki User

17y ago

What else can I help you with?

Related Questions

How many hydrogen atoms are present in 3-methyl-4-propyl-3-octene?

CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen


How many hydrogen atoms are present in the molecule 2 5 dimethyloctane?

In 2,5-dimethyloctane, there are 22 hydrogen atoms. Each methyl (CH3) group has 3 hydrogen atoms, so for two methyl groups, it would be 2 x 3 = 6 hydrogen atoms. Octane has 16 hydrogen atoms. Therefore, 6 + 16 = 22 hydrogen atoms in total for 2,5-dimethyloctane.


Does methyl group consists of a carbon bonded to three hydrogen atoms?

Yes, a methyl group consists of three hydrogen atoms bonded to a carbon atom, with a univalent radical. Add one hydrogen atom and you have methane.


How many hydrogen atoms would be needed to complete the following structure CC-O-C?

Eight hydrogen atoms are necessary (ethyl methyl ether).


What is the methyl skeletal structure of the compound in question?

The methyl skeletal structure of a compound refers to the arrangement of carbon and hydrogen atoms in the molecule. It shows how the carbon atoms are connected to each other and to the hydrogen atoms.


What is Methyl acetate made of?

Carbon, hydrogen, and oxygen atoms; the molecular formula of methyl acetate is C3H6O2.


How many hydrogen atoms are in 1-methylcyclopropane?

There are five hydrogen atoms in 1-methylcyclopropane. Each carbon atom in the cyclopropane ring is bonded to one hydrogen atom, and the methyl group attached to one of the carbons adds three more hydrogen atoms.


How many bonding pairs of electrons in methyl fluoride?

Methyl fluoride (CH3F) has three bonding pairs of electrons between carbon and hydrogen atoms in the methyl group, and one bonding pair of electrons between carbon and fluorine atoms. Therefore, there are a total of four bonding pairs of electrons in methyl fluoride.


What groups consists of carbon and hydrogen atoms and can control whether genes make proteins or remain silent?

Methyl groups


What functional group contains 1 C atom and 3 H atoms?

The functional group that contains 1 carbon atom and 3 hydrogen atoms is a methyl group, denoted as -CH3. This group consists of a carbon atom bonded to three hydrogen atoms. It is commonly found in organic compounds.


What is another word for methyl?

Methyl is derived from methane. It is one carbon atom which is bonded to three hydrogen atoms. The methyl group comes in 3 forms: anion; cation or radical.


What is the molecular formula of the Methyl Group?

The molecular formula of the methyl group is CH3. It consists of one carbon atom bonded to three hydrogen atoms.