0
What else can I help you with?
How many o atoms are in sodium hypochlorite?
There are three oxygen atoms in sodium hypochlorite (NaClO).
How many sodium atoms make up the sodium element?
23 g of sodium metal will have 6.023 x 1023 atoms (or 1 mole of atoms)
How many atoms of sodium are represented by 6 Na?
6 Na means 6 atoms of Sodium 6 Na means 6 atoms of Sodium
How many atoms in sodium sulfide?
In one formula unit of sodium sulfide (Na2S), there are 3 atoms - 2 atoms of sodium (Na) and 1 atom of sulfur (S).
How many atoms are in sodium acetate?
The molecular formula of sodium acetate is (NaCH_3COO). This means there are 3 carbon atoms, 3 hydrogen atoms, 2 oxygen atoms, and 1 sodium atom in a molecule of sodium acetate. In total, there are 9 atoms in a molecule of sodium acetate.
How many carbon atoms do MSG have?
Monosodium glutamate has 5 carbon atoms.
Why does Campbell's put mono sodium glutamate in their soup which causes weight gain?
Monosodium glutamate is put into many foods to preserve them longer.
What is ajinomotto?
Ajino - moto is the flavouring used in many dishes. Mainly it is mono-sodium glutamate.
Is MSG a drug?
No. MSG (monosodium glutamate) is a flavor enhancer used in many different types of foods.
What are the advantages of monosodium glutamate?
A flavouring enhancement substance added to food,used to improve the taste of many processed foods.
If glutamic acid has the formula HC5H8NO4 then what is the formula of sodium glutamate commonly known as MSG or monosodium glutamate?
MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.
How many atoms of sodium are there in 0.200 moles sodium atoms?
0,2 mol sodium contain 1,204.10e23 atoms.
Asians consider this chemical to be the fifth taste sensation Many North Americans say that it gives them Chinese Restaurant Syndrome What is this chemical?
The chemical is called monosodium glutamate (MSG). Asians consider it the fifth taste sensation known as umami, while some North Americans report experiencing symptoms such as headaches and sweating after consuming it, known as Chinese Restaurant Syndrome.
What is the ordinary names of monosudiumglutamate?
Monosodium glutamate is used as a taste enhancer in the food industry, and comes under many chemical and trade names. It imparts a taste called "umami".
How many sodium atoms are in a molecule borax?
Borax has two sodium atoms.
How many sodium atoms in Na2O?
There are two sodium atoms in each molecule of Na2O, as indicated by the subscript immediately after the symbol for sodium atoms in the formula.
How many sodium atoms are in a molecule of a borax?
Borax - Na2B4O7 - contain two sodium atoms.
