answersLogoWhite

0


Best Answer

One atom, because Mono- means One

User Avatar

Wiki User

11y ago
This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: How many atoms of sodium in a monosodium of glutamate?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

How many carbon atoms do MSG have?

Monosodium glutamate has 5 carbon atoms.


Why does Campbell's put mono sodium glutamate in their soup which causes weight gain?

Monosodium glutamate is put into many foods to preserve them longer.


What is ajinomotto?

Ajino - moto is the flavouring used in many dishes. Mainly it is mono-sodium glutamate.


Is MSG a drug?

No. MSG (monosodium glutamate) is a flavor enhancer used in many different types of foods.


What are the advantages of monosodium glutamate?

A flavouring enhancement substance added to food,used to improve the taste of many processed foods.


If glutamic acid has the formula HC5H8NO4 then what is the formula of sodium glutamate commonly known as MSG or monosodium glutamate?

MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.


Asians consider this chemical to be the fifth taste sensation Many North Americans say that it gives them Chinese Restaurant Syndrome What is this chemical?

Monosodium glutamate


How many atoms of sodium are there in 0.200 moles sodium atoms?

0,2 mol sodium contain 1,204.10e23 atoms.


How many sodium atoms are in a molecule borax?

Borax has two sodium atoms.


What is the ordinary names of monosudiumglutamate?

Monosodium glutamate is used as a taste enhancer in the food industry, and comes under many chemical and trade names. It imparts a taste called "umami".


How many atoms atoms does sodium hydroxide have?

Sodium hydroxide is NaOH and contains three atoms, one each of sodium, hydrogen and oxygen.


How many sodium atoms are in a molecule of a borax?

Borax - Na2B4O7 - contain two sodium atoms.