0
NO. Sulfates are irritating in part because they're small molecules that can penetrate the skin. Disodium Laureth Sulfosuccinate is a larger molecule that can't penetrate skin.
Disodium Laureth Sulfosuccinate is known to be very gentle to the skin, even at very high concentrations it remains non-irritating to even sensitive skin types.
Disodium Laureth Sulfosuccinate has not been sulfated in the production process which makes it free of sulfates. Even though it may sound alike, it is not a Laurel Sulfate.
all in all, If you own a shampoo that is sulfate free, but contains sulfosuccinate, then you are ok, this is not harming your hair.
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
Can sodium succinate used instead of sodium sulfosuccinate?
The answer to this question would seem to depend on the purpose intended for the sodium sulfosuccinate.
What is dioctyl sodium sulfosuccinate?
aka docusate sodium, a stool softener.
Is copper sulfate a metal?
Copper sulfate is not a metal There are two compounds called Copper Sulfate, which are salts of the metal Copper. CuSO4 is Copper (II) Sulfate, once known as Cupric Sulfate. Cu2SO4 is Copper (I) Sulfate, once known as Cuprous Sulfate.
What is the Formula for copper (I) sulfate?
Copper sulfate has CuSO4 as its formula. Copper sulfate is also written copper (II) sulfate.
Whats the correct name and formula for sulfate?
sulfate. SO4 Sulfate. SO4
Is sulfosuccinate a sulfa?
no
Can sodium succinate used instead of sodium sulfosuccinate?
The answer to this question would seem to depend on the purpose intended for the sodium sulfosuccinate.
Is soduim diocytl sulfosuccinate an aromatic?
Not
What is DOSS?
dioctyl sodium sulfosuccinate
What is disodium lauryl sulfosuccinate?
It's sodium lauryl ether sulfate, a class of chemicals having the general formula CH3(CH2)11(OCH2CH2)nSO4Na where nis usually a fairly small number such as 2 or 3. As you can probably guess from the formula, it's a surfactant. It's used in shampoos and other cleansers.
What is dioctyl sodium sulfosuccinate?
aka docusate sodium, a stool softener.
What is the name of the ionic compound K2SO4?
i think either potassium(II) sulfate or potassium sulfate
Is copper sulfate a metal?
Copper sulfate is not a metal There are two compounds called Copper Sulfate, which are salts of the metal Copper. CuSO4 is Copper (II) Sulfate, once known as Cupric Sulfate. Cu2SO4 is Copper (I) Sulfate, once known as Cuprous Sulfate.
What is the Formula for copper (I) sulfate?
Copper sulfate has CuSO4 as its formula. Copper sulfate is also written copper (II) sulfate.
What is the formula for copper(I) sulfate?
Copper sulfate has CuSO4 as its formula. Copper sulfate is also written copper (II) sulfate.
Whats the correct name and formula for sulfate?
sulfate. SO4 Sulfate. SO4
What is the synonym of copper sulfate?
copper sulfate, cupric sulfate, cupric sulphate.l
