0
NO. Sulfates are irritating in part because they're small molecules that can penetrate the skin. Disodium Laureth Sulfosuccinate is a larger molecule that can't penetrate skin.
Disodium Laureth Sulfosuccinate is known to be very gentle to the skin, even at very high concentrations it remains non-irritating to even sensitive skin types.
Disodium Laureth Sulfosuccinate has not been sulfated in the production process which makes it free of sulfates. Even though it may sound alike, it is not a Laurel Sulfate.
all in all, If you own a shampoo that is sulfate free, but contains sulfosuccinate, then you are ok, this is not harming your hair.
What else can I help you with?
Can sodium succinate used instead of sodium sulfosuccinate?
No, sodium succinate and sodium sulfosuccinate are different compounds with different properties. Sodium sulfosuccinate is a surfactant commonly used in pharmaceuticals and personal care products, while sodium succinate is a compound often used as a buffering agent in the food and pharmaceutical industries. Substituting one for the other may lead to undesired effects or changes in product performance.
What is dioctyl sodium sulfosuccinate?
Dioctyl sodium sulfosuccinate is a surfactant commonly used in pharmaceuticals, cosmetics, and personal care products. It helps to reduce surface tension and improve the solubility of various substances in formulations. Additionally, it can act as an emulsifier and wetting agent in different applications.
What is the Formula for copper (I) sulfate?
Copper sulfate has CuSO4 as its formula. Copper sulfate is also written copper (II) sulfate.
Anion for ammonium sulfate?
The anion for ammonium sulfate is sulfate (SO4^2-). Ammonium sulfate is a salt that consists of the ammonium cation (NH4^+) and the sulfate anion.
What is the valency of sulfate?
the valancie of sulfate is 2- its formular is SO42-
Is a shampo with sulfosuccinate sulfate free?
Sulfosuccinate is a sulfate-based surfactant, so a shampoo containing sulfosuccinate is not sulfate-free. Sulfates are commonly used in shampoos for their cleansing properties but can be harsh on hair and scalp. If you're looking for a sulfate-free option, you may want to choose a shampoo that does not contain sulfates or opt for milder surfactants.
Is sulfosuccinate a sulfa?
no
Is soduim diocytl sulfosuccinate an aromatic?
Not
What is DOSS?
dioctyl sodium sulfosuccinate
Can sodium succinate used instead of sodium sulfosuccinate?
No, sodium succinate and sodium sulfosuccinate are different compounds with different properties. Sodium sulfosuccinate is a surfactant commonly used in pharmaceuticals and personal care products, while sodium succinate is a compound often used as a buffering agent in the food and pharmaceutical industries. Substituting one for the other may lead to undesired effects or changes in product performance.
What is disodium lauryl sulfosuccinate?
It's sodium lauryl ether sulfate, a class of chemicals having the general formula CH3(CH2)11(OCH2CH2)nSO4Na where nis usually a fairly small number such as 2 or 3. As you can probably guess from the formula, it's a surfactant. It's used in shampoos and other cleansers.
What is dioctyl sodium sulfosuccinate?
Dioctyl sodium sulfosuccinate is a surfactant commonly used in pharmaceuticals, cosmetics, and personal care products. It helps to reduce surface tension and improve the solubility of various substances in formulations. Additionally, it can act as an emulsifier and wetting agent in different applications.
Is sodium laureth sulfate considered a sulfate?
Yes, sodium laureth sulfate is considered a sulfate.
What is the name of the ionic compound K2SO4?
i think either potassium(II) sulfate or potassium sulfate
What is the Formula for copper (I) sulfate?
Copper sulfate has CuSO4 as its formula. Copper sulfate is also written copper (II) sulfate.
What is the formula for copper(I) sulfate?
Copper sulfate has CuSO4 as its formula. Copper sulfate is also written copper (II) sulfate.
What is the synonym of copper sulfate?
copper sulfate, cupric sulfate, cupric sulphate.l
