0
The answer to this question would seem to depend on the purpose intended for the sodium sulfosuccinate.
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
Can sodium chloride be used to make soap instead of lye?
No, because sodium chloride isn't alkaline; you could use sodium hydroxide instead of potassium hydroxide (lye) but sodium chloride wouldn't work very well.
Why should large crystals of sodium chloride be used instead of small crystals?
What is the context? Is this a lab or what?
Why is magnesium hydroxide used as an antacid instead of sodium hydroxide?
Sodium Hydroxide is way too basic (very high pH) and would cause internal damage.
What does Ammonium Succinate do?
It is used in foods, medicines, and in production of bio-fuels. See the link at the bottom of the page for more information.
Why not aqueous solution of sodium chloride used instead of molten?
Aqueous solutions indicate that the substance is dissolved in water, whereas molten is where the substance is pure, so there is no water.
What is disodium lauryl sulfosuccinate?
It's sodium lauryl ether sulfate, a class of chemicals having the general formula CH3(CH2)11(OCH2CH2)nSO4Na where nis usually a fairly small number such as 2 or 3. As you can probably guess from the formula, it's a surfactant. It's used in shampoos and other cleansers.
Can sodium chloride be used to make soap instead of lye?
No, because sodium chloride isn't alkaline; you could use sodium hydroxide instead of potassium hydroxide (lye) but sodium chloride wouldn't work very well.
What will happen if mercury lamp is used instead of sodium lamp in plane diffraction grating exp?
for diffraction grating mercury lamp is used not sodium lamp.
Could sodium chromate be used instead of potassium chromate?
Yes, because chemical properties of sodium and potassium ions are nearly same.
Why should large crystals of sodium chloride be used instead of small crystals?
What is the context? Is this a lab or what?
What fluid instead of water can be used as a heat transfer in domestic heating system?
Liquid sodium
Why do you use molten NaCl in electrolysis instead of an aqueous solution of NaCl?
Molten salt electrolysis is used to obtain sodium and chlorine. Electrolysis of the water solution is used to obtain sodium hydroxide and hydrogen.
Why is magnesium hydroxide used as an antacid instead of sodium hydroxide?
Sodium Hydroxide is way too basic (very high pH) and would cause internal damage.
Why electrolysis does not happen in solid sodium chloride?
when an aqueous solution is used, hydrogen gas is evolved at cathode, instead of depositing sodium metal.
Why is potassium iodide used in iodometric titrations instead of sodium iodide?
I would guess that this is so because of potassium's mass, being much more than, sodium's molar mass per ion. So can sodium iodide be used instead of potassium iodide? Perhaps, but maybe not to the same level effectiveness. Potassium molecules have been known to dissolve better than sodium molecules. One example is Potassium Chloride and Sodium Chloride thanks
What is papad khar?
Papad khar is an Indian term for alkaline salt - sodium benzoate which is widely used as a food preservative known - E211. Alternatively you can use Sodium Carbonate and Sodium Bicarbonate in 2:1 ratio instead of Papad Khar
What it sodium used for?
sodium is used for cooking or sodium hycloptorite is used for killing bacteria and is found in bleach
