0
What else can I help you with?
Can sodium succinate used instead of sodium sulfosuccinate?
No, sodium succinate and sodium sulfosuccinate are different compounds with different properties. Sodium sulfosuccinate is a surfactant commonly used in pharmaceuticals and personal care products, while sodium succinate is a compound often used as a buffering agent in the food and pharmaceutical industries. Substituting one for the other may lead to undesired effects or changes in product performance.
Is sulfosuccinate a sulfate?
NO. Sulfates are irritating in part because they're small molecules that can penetrate the skin. Disodium Laureth Sulfosuccinate is a larger molecule that can't penetrate skin. Disodium Laureth Sulfosuccinate is known to be very gentle to the skin, even at very high concentrations it remains non-irritating to even sensitive skin types. Disodium Laureth Sulfosuccinate has not been sulfated in the production process which makes it free of sulfates. Even though it may sound alike, it is not a Laurel Sulfate. all in all, If you own a shampoo that is sulfate free, but contains sulfosuccinate, then you are ok, this is not harming your hair.
What is a word equation for sodium and chlorine?
Sodium + Chlorine ---> Sodium Chloride I think that is correct
What is the name of the compound Na3PO3?
Sodium phosphide
Another name for sodium acetate?
Sodium Acetate is also known as Sodium Ethanoate.
What is DOSS?
dioctyl sodium sulfosuccinate
Can sodium succinate used instead of sodium sulfosuccinate?
No, sodium succinate and sodium sulfosuccinate are different compounds with different properties. Sodium sulfosuccinate is a surfactant commonly used in pharmaceuticals and personal care products, while sodium succinate is a compound often used as a buffering agent in the food and pharmaceutical industries. Substituting one for the other may lead to undesired effects or changes in product performance.
Is sulfosuccinate a sulfa?
no
Is soduim diocytl sulfosuccinate an aromatic?
Not
What are wetting agents added to drugs?
Wetting agents help improve tablet disintegration and dissolution. Examples include sodium lauryl sulphate and sodium dioctyl sulphosuccinate. They are used in small amounts (i.e. around 0.2%) as they may cause stomach irritation.
Is sulfosuccinate a sulfate?
NO. Sulfates are irritating in part because they're small molecules that can penetrate the skin. Disodium Laureth Sulfosuccinate is a larger molecule that can't penetrate skin. Disodium Laureth Sulfosuccinate is known to be very gentle to the skin, even at very high concentrations it remains non-irritating to even sensitive skin types. Disodium Laureth Sulfosuccinate has not been sulfated in the production process which makes it free of sulfates. Even though it may sound alike, it is not a Laurel Sulfate. all in all, If you own a shampoo that is sulfate free, but contains sulfosuccinate, then you are ok, this is not harming your hair.
Is a shampo with sulfosuccinate sulfate free?
Sulfosuccinate is a sulfate-based surfactant, so a shampoo containing sulfosuccinate is not sulfate-free. Sulfates are commonly used in shampoos for their cleansing properties but can be harsh on hair and scalp. If you're looking for a sulfate-free option, you may want to choose a shampoo that does not contain sulfates or opt for milder surfactants.
What are the Products manufactured by Dioctyl Phthalate?
In the US, Dioctyl phthalate (DOP) has FDA approval for use in flexible medical items made of polyvinyl chloride (pvc) plastic. DOP is found in medical tubing, blood bags, etc.
Is dioctyl phthalate classify as dangerous good?
Yes, dioctyl phthalate is classified as a hazardous substance. It is considered harmful if ingested, inhaled, or if it comes into contact with the skin and eyes. It is important to handle and store it properly to prevent any health risks.
What is disodium lauryl sulfosuccinate?
It's sodium lauryl ether sulfate, a class of chemicals having the general formula CH3(CH2)11(OCH2CH2)nSO4Na where nis usually a fairly small number such as 2 or 3. As you can probably guess from the formula, it's a surfactant. It's used in shampoos and other cleansers.
What has dioctyl ammonium?
Can't think of anything specific, but surfactants would be a good place to look: soaps, detergents, etc.
What evaporates when you put vinyl in the air?
I think you're probably talking about the plasticizer. A common one would be dioctyl phthalate, but there are others.
