0
aka docusate sodium, a stool softener.
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
Can sodium succinate used instead of sodium sulfosuccinate?
The answer to this question would seem to depend on the purpose intended for the sodium sulfosuccinate.
Is sulfosuccinate a sulfate?
NO. Sulfates are irritating in part because they're small molecules that can penetrate the skin. Disodium Laureth Sulfosuccinate is a larger molecule that can't penetrate skin. Disodium Laureth Sulfosuccinate is known to be very gentle to the skin, even at very high concentrations it remains non-irritating to even sensitive skin types. Disodium Laureth Sulfosuccinate has not been sulfated in the production process which makes it free of sulfates. Even though it may sound alike, it is not a Laurel Sulfate. all in all, If you own a shampoo that is sulfate free, but contains sulfosuccinate, then you are ok, this is not harming your hair.
What are some common items that sodium is in?
Examples: sodium chloride, sodium carbonate, sodium hydrogen carbonate, sodium hydroxide, sodium sulfide, sodium acetate, sodium bromide, borax, etc.
What is the name of the compound Na3PO3?
Sodium phosphide
Another name for sodium acetate?
Sodium Acetate is also known as Sodium Ethanoate.
What is DOSS?
dioctyl sodium sulfosuccinate
Can sodium succinate used instead of sodium sulfosuccinate?
The answer to this question would seem to depend on the purpose intended for the sodium sulfosuccinate.
Is sulfosuccinate a sulfa?
no
Is soduim diocytl sulfosuccinate an aromatic?
Not
What are wetting agents added to drugs?
Wetting agents help improve tablet disintegration and dissolution. Examples include sodium lauryl sulphate and sodium dioctyl sulphosuccinate. They are used in small amounts (i.e. around 0.2%) as they may cause stomach irritation.
Is sulfosuccinate a sulfate?
NO. Sulfates are irritating in part because they're small molecules that can penetrate the skin. Disodium Laureth Sulfosuccinate is a larger molecule that can't penetrate skin. Disodium Laureth Sulfosuccinate is known to be very gentle to the skin, even at very high concentrations it remains non-irritating to even sensitive skin types. Disodium Laureth Sulfosuccinate has not been sulfated in the production process which makes it free of sulfates. Even though it may sound alike, it is not a Laurel Sulfate. all in all, If you own a shampoo that is sulfate free, but contains sulfosuccinate, then you are ok, this is not harming your hair.
What is disodium lauryl sulfosuccinate?
It's sodium lauryl ether sulfate, a class of chemicals having the general formula CH3(CH2)11(OCH2CH2)nSO4Na where nis usually a fairly small number such as 2 or 3. As you can probably guess from the formula, it's a surfactant. It's used in shampoos and other cleansers.
What are the Products manufactured by Dioctyl Phthalate?
In the US, Dioctyl phthalate (DOP) has FDA approval for use in flexible medical items made of polyvinyl chloride (pvc) plastic. DOP is found in medical tubing, blood bags, etc.
What has dioctyl ammonium?
Can't think of anything specific, but surfactants would be a good place to look: soaps, detergents, etc.
What evaporates when you put vinyl in the air?
I think you're probably talking about the plasticizer. A common one would be dioctyl phthalate, but there are others.
What is the formula for c-4?
C4 is 91% RDX (cyclonite or cyclotrimethylene trinitramine), (5.3%) iethylhexyl or dioctyl sebacate and a binder (2.1%) polyisobutylene.
What are the ingredients in a Burger King Stacker?
Choose from double, triple, or even quadruple-stacked layers of beef and cheese - topped with bacon and sauce. They call it a stacker sauce, but it is similar to thousand island dressing.
