answersLogoWhite

0

NaOC(=O)CH3 + HClO4 --> HOC(=O)CH3 + Na+ClO4-

Perchloric acid is a strong acid, so the acetate anion takes the proton from perchloric acid.

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

What is the reaction between acetyl chloride and sodium acetate?

The reaction between acetyl chloride and sodium acetate would likely result in the formation of acetic anhydride and sodium chloride. Acetyl chloride would react with the sodium acetate to form acetic anhydride, along with sodium chloride as a byproduct.


What is the reaction of calcium acetate and sodium carbonate?

The reaction between calcium acetate and sodium carbonate will produce calcium carbonate and sodium acetate. This is a double displacement reaction where the cations and anions switch partners.


What is sodium acetate made?

Sodium acetate is typically produced by the reaction of acetic acid with sodium hydroxide or sodium carbonate. This reaction forms sodium acetate and water. The compound can also be obtained from the reaction of sodium hydroxide with acetic anhydride.


What is the reaction between ascetic acid and sodium acetate?

Any reaction occur in this case.


Reaction between soda lime and sodium acetate?

When soda lime (a mixture of calcium hydroxide and sodium hydroxide) comes in contact with sodium acetate, a base-acid reaction will occur. The sodium acetate will react with the hydroxide ions from the soda lime to form sodium hydroxide and acetic acid. This reaction will result in the neutralization of sodium acetate and the formation of sodium hydroxide and acetic acid as the products.


What is the reaction between sodium hydride and ethyl acetate?

The reaction between sodium hydride and ethyl acetate would likely result in the formation of sodium acetate and hydrogen gas. Sodium hydride would react with the acidic hydrogen in ethyl acetate to form sodium acetate, while releasing hydrogen gas as a byproduct.


What is the chemical reaction between sodium acetate and sodium hydroxide?

When sodium acetate reacts with sodium hydroxide, a double displacement reaction occurs. The products of the reaction are sodium hydroxide and sodium acetate. The balanced chemical equation for this reaction is: CH3COONa + NaOH → CH3COONa + NaOH


Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).


What is the reaction for Sodium acetate plus H2O?

The reaction between sodium acetate and water is a dissolution process where sodium acetate dissociates into its ions (sodium and acetate) when placed in water. The equation for this process is: CH3COONa + H2O → CH3COO- + Na+ + H2O


What is the word equation for reaction between baking soda and vinegar?

The word equation for the reaction between baking soda (sodium bicarbonate) and vinegar (acetic acid) is: sodium bicarbonate + acetic acid → sodium acetate + water + carbon dioxide. In this reaction, the acetic acid reacts with sodium bicarbonate to produce sodium acetate, water, and carbon dioxide gas, which is responsible for the fizzing effect.


Sodium acetate from glacial acetic acid?

To prepare sodium acetate from glacial acetic acid, you can first neutralize the glacial acetic acid with sodium hydroxide. The reaction will yield sodium acetate and water. Afterward, you can evaporate the water to obtain solid sodium acetate crystals.


What is the balanced molecular equation for sodium acetate and silver nitrate?

The balanced molecular equation for the reaction between sodium acetate (NaC2H3O2) and silver nitrate (AgNO3) is: 2NaC2H3O2 + AgNO3 -> 2AgC2H3O2 + NaNO3