0
Sodium generally does not react with water in the tradition sense. The primary source of sodium in water is from sodium chloride, which breaks down into sodium and chloride ions in water ("dissolves").
For NaCl dissolving in water:
NaCl (s) <--> Na+ (aq) + Cl- (aq)
(S=Solid, Aq=Aqueous)
Once it is an ion in water, Na+ generally does not react with water.
Since the oxygen in water is partially negative and the hydrogen in water is partially positive, Na+ ions like associating with with the oxygen in water, while Cl- ions like associating with the hydrogen in water.
What else can I help you with?
What is the balance chemical equation of sodium and water?
The balanced chemical equation for the reaction of sodium with water is: 2Na + 2H2O -> 2NaOH + H2
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the chemical equation of ethanoic acid reacting with sodium hydroxide?
The chemical equation for the reaction between ethanoic acid (acetic acid) and sodium hydroxide is: CH3COOH + NaOH → CH3COONa + H2O This reaction is a neutralization reaction that forms sodium acetate and water.
What is the general equation for water and sodium carbonate?
No chemical reaction between water and sodium carbonate, only solving of the sodium carbonate in water.
What is the equation for sodium with water produces sodium hydroxide and hydrogen?
The chemical equation for the reaction of sodium with water to produce sodium hydroxide and hydrogen gas is: (2Na + 2H_2O \rightarrow 2NaOH + H_2)
What is the balance chemical equation of sodium and water?
The balanced chemical equation for the reaction of sodium with water is: 2Na + 2H2O -> 2NaOH + H2
What is the chemical equation of this reaction Solid sodium chloride dissolves in water.?
Sodium chloride is dissociated in water: NaCl---------------------Na+ + Cl-
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the chemical equation of ethanoic acid reacting with sodium hydroxide?
The chemical equation for the reaction between ethanoic acid (acetic acid) and sodium hydroxide is: CH3COOH + NaOH → CH3COONa + H2O This reaction is a neutralization reaction that forms sodium acetate and water.
What is the general equation for water and sodium carbonate?
No chemical reaction between water and sodium carbonate, only solving of the sodium carbonate in water.
What is the equation for sodium with water produces sodium hydroxide and hydrogen?
The chemical equation for the reaction of sodium with water to produce sodium hydroxide and hydrogen gas is: (2Na + 2H_2O \rightarrow 2NaOH + H_2)
Equation for combination of acetic acid-water-chloroform with sodium hydroxide?
The reaction of acetic acid and sodium hydroxide will form sodium acetate and water. The chloroform is not involved in the reaction and will remain unchanged. The balanced chemical equation for the reaction is: CH3COOH (acetic acid) + NaOH (sodium hydroxide) -> CH3COONa (sodium acetate) + H2O (water)
What Sodium (Na) and water (H2O) undergo a chemical reaction that produces sodium hydroxide (NaOH and hydrogen gas (H2). Which equation represents this chemical reaction?
The chemical equation representing this reaction is 2Na + 2H2O → 2NaOH + H2.
What is the chemical equation showing the reaction between sodium and water?
2Na + H2O -> 2NaOH+H2
What is the product of a reaction that take place when sodium oxide combines with water?
The reaction between sodium oxide (Na2O) and water (H2O) forms sodium hydroxide (NaOH). The chemical equation for this reaction is: Na2O + H2O -> 2NaOH
How does sodium oxide and water make sodium hydroxide?
When sodium oxide reacts with water, it undergoes a chemical reaction to form sodium hydroxide. This reaction involves the hydration of sodium oxide, which results in the formation of sodium hydroxide as a product. The chemical equation for this reaction is: Na2O + H2O → 2NaOH.
What is the chemical equation for the reaction of soda ash and citric acid?
The chemical equation for the reaction of soda ash (sodium carbonate) and citric acid is: 3Na2CO3 + 2C6H8O7 → 2Na3C6H5O7 + 3H2O + 3CO2. This reaction produces sodium citrate, water, and carbon dioxide as products.
