Yes, C17H35COOH is polar because it contains a carboxyl group (–COOH) which is a polar functional group due to the electronegativity difference between the oxygen and carbon atoms.
The balanced equation for the reaction of a fatty acid (such as stearic acid) and sodium hydroxide is: C17H35COOH + NaOH -> C17H35COONa + H2O This reaction produces a salt (sodium stearate) and water.
CH3CH3 ethane is saturated. CH2=CH2 ethene (ethylene) is unstaurated. C17H35COOH stearic acid is saturated. C17H33COOH oleic acid is unsaturated. C17H29COOH Linolenic acid is polyunstaurated.
When stearic acid is added to potassium hydroxide (KOH), it undergoes saponification to form potassium stearate and water. This reaction is commonly used in soap making processes. The reaction can be represented by the chemical equation: C17H35COOH + KOH -> C17H35COOK + H2O
Olive oil is a triacylglyceride (three (3) fatty acids attached to a glycerol base), a type of glycerolipid. Olive oil is primarily three Oleic acid is monounsaturated and makes up 55-85% of olive oil (C17H35COOH)or CH3-(CH2)7-CH=CH-(CH2)7-COOH also known as oleate. Linoleic is polyunsaturated and makes up about 9% (C17H29COOH) or CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7-COOH Linolenic, which is polyunsaturated, makes up 0-1.5%
An example of a fatty acid is linoleic acid, which is an essential omega-6 fatty acid found in various plant-based oils and seeds. It plays a crucial role in maintaining skin health, promoting proper cell function, and supporting overall well-being.
Fat is not a polymere, however most fats are threefold esters of glycerol (1,2,3-propanetriol) and three (different) long chain fatty acids.Example:stearine (or tristearin, or glyceryl tristearate) is made by esterfication (three times):C3H5(OH)3 + 3 C17H35COOH → C3H5(C18H35O2)3 + 3 H2O
The specific chemical structure of oils vary, but they all follow the same basic patterns. They are called triglycerides, because they are made of a glycerol molecule bonded with three hydrocarbon chains, called fatty acids. Although, there are rare cases when triglycerides break down, often through cooking, and become diglycerides, or monoglycerides, with only two or one fatty acid per glycerol molecule.Cannot be specified without knowing source. All oils are mixtures of different hydrocarbons, some linear, some rings, some saturated, some unsaturated, some have non-hydrocarbon side groups attached, some are crosslinked, etc.
olive oilYes it is a hydrocarbon, like all organic materials, but it isn't a carbohydrate :) It's pure fat, like all oils.Olive OilOlive oil is a triacylgylceride: three fatty acids attached to a glycerol backbone. Technically it is a type of glycerolipid. Triacylglycerols(Triglycerides or Fats) are the major energy reserve for plants and animals.Fatty Acids:Olive Oil is a complex compound made of fatty acids, vitamins, volatile components, water soluble components and microscopic bits of olive. Primary fatty acids are Oleic and linoleic acid with a small amount of linolenic acid.A fatty acid has the general formula: CH3(CH2)nCOOH where n is typically an even number between 12 and 22If no double bonds are present the molecule is called a saturated fatty acid.If a chain contains double bonds, it is called an unsaturated fatty acid.A single double bond makes a monounsaturated fatty acidOils with more that one double bond are called polyunsaturated fatty acids.Oleic acid is monounsaturated and makes up 55-85% of olive oil (C17H35COOH) or CH3-(CH2)7-CH=CH-(CH2)7-COOH also known as oleate.The IUPAC name would be cis-9-octadecenoateLinoleic is polyunsaturated and makes up about 9% (C17H29COOH) or CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7-COOHLinolenic, which is polyunsaturated, makes up 0-1.5%