0
In Chapter 3 of "Zach's Lie," Zach is forced to confront the reality of his new life after his family goes into witness protection. He struggles with his identity and the challenges of adapting to a new environment and school while keeping his past a secret. This chapter highlights his feelings of isolation and the tension between his old life and the necessity of starting anew. Zach's internal conflict becomes more pronounced as he navigates the complexities of his situation.
What else can I help you with?
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What are some flashbacks in zachs lie?
they are thinking back at what happen with their dad
In the book zachs lie what is zachs fathers name?
Neil Osborne
What city is Zach osborne from in the book zachs lie?
In the book "Zach's Lie," Zach Osborne is from Elko, Nevada.
Who is alonzo in zachs lie?
he is a drug shipper that shared partnership with mr. osborn
What did the police take in zachs lie?
pretty much everything, phone, ipod, tv enerything that could relate him back to being jack
What is the genre of zachs lie?
"Zach's Lie" is a young adult thriller novel. It blends elements of suspense, mystery, and drama as it follows the story of a teenager who is forced into a witness protection program after his father is accused of a crime.
How many Zach's are in the world?
Scientists have determined that there are exactly 10 zachs in the world. The population of zachs greatly decreased following WWII because many Zachs at the time were Jewish.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What will happen if you lie to a referee?
whats happens if you lie to a referee
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the conflict in the book zachs lie?
The main conflict in "Zach's Lie" revolves around Zach's family being placed in witness protection after witnessing a crime. Zach struggles to adapt to his new identity and life, all while dealing with the fear of being discovered by the criminals he testified against.
