0
What else can I help you with?
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
Decane can be broken during this process to form 1- butene and 2 - methylpentanewrite anequation using structural formulae to show this reaction?
The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.
What are some flashbacks in zachs lie?
they are thinking back at what happen with their dad
In the book zachs lie what is zachs fathers name?
Neil Osborne
What city is Zach osborne from in the book zachs lie?
In the book "Zach's Lie," Zach Osborne is from Elko, Nevada.
Who is alonzo in zachs lie?
he is a drug shipper that shared partnership with mr. osborn
What did the police take in zachs lie?
pretty much everything, phone, ipod, tv enerything that could relate him back to being jack
What is the genre of zachs lie?
"Zach's Lie" is a young adult thriller novel. It blends elements of suspense, mystery, and drama as it follows the story of a teenager who is forced into a witness protection program after his father is accused of a crime.
How many Zach's are in the world?
Scientists have determined that there are exactly 10 zachs in the world. The population of zachs greatly decreased following WWII because many Zachs at the time were Jewish.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What will happen if you lie to a referee?
whats happens if you lie to a referee
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
