0
What else can I help you with?
How can bacterial populations develop drug resistance and share that resistance with other bacteria?
Bacterial populations can develop drug resistance through mutations that make them less susceptible to antibiotics. They can also acquire resistance genes from other bacteria through mechanisms like conjugation, transformation, or transduction, allowing them to share resistance traits. This exchange of genetic material can lead to the rapid spread of drug resistance among bacterial populations.
What is chioromphinacol?
Chloramphenicol is an antibiotic, inhibits the synthesis of proteins in bacteria. Aparently Chloramphenicol interfer during the transfer of amino acids from RNA-bound amino acids to Ribosome
What is the chemical composition of Chloroamphenicol suspforulation?
Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful."suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.
Why chloramphenicol causes gray baby syndrome?
Chloramphenicol is metabolized by the liver. A baby's liver is not mature enough to metabolize this drug. Therefore the levels of Chloramphenicol increase in the baby's body, as there is no way for the baby to get rid of the drug. This causes cardiovascular collapse (severe hypotension), cyanosis, flaccidity, and vomiting.
What does the term resistance means in microbiology?
In microbiology, resistance refers to the ability of microorganisms to survive and grow in the presence of antimicrobial agents, such as antibiotics. Microorganisms can develop resistance through various mechanisms, such as genetic mutations or acquiring resistance genes from other organisms. This can pose challenges in the treatment of infectious diseases.
What has the author Stephen Michael Kane written?
Stephen Michael Kane has written: 'The clinical pharmacokinetics of chloramphenicol and chloramphenicol succinate'
Is chloramphenicol an aminoglycoside?
No, it is a class apart.
What does 'mechanisms of microbial drug resistance' mean?
exactly what it says. it is a mechanism that confers drug resistance to microbes. exactly what it says. it is a mechanism that confers drug resistance to microbes.
What are the five general mechanisms of resistance as identified by David W?
The five general mechanisms of resistance identified by David W. in the context of psychotherapy are denial, regression, acting out, transference, and projection. These mechanisms are common ways individuals may unconsciously defend against uncomfortable thoughts, feelings, or experiences in therapy.
What is centimeters antibiotics?
Cm is an abbreviation for chloramphenicol
What liquid antibiotic starts with ch?
CHLORAMPHENICOL OR CHLOROMYCETIN
How can bacterial populations develop drug resistance and share that resistance with other bacteria?
Bacterial populations can develop drug resistance through mutations that make them less susceptible to antibiotics. They can also acquire resistance genes from other bacteria through mechanisms like conjugation, transformation, or transduction, allowing them to share resistance traits. This exchange of genetic material can lead to the rapid spread of drug resistance among bacterial populations.
What is chioromphinacol?
Chloramphenicol is an antibiotic, inhibits the synthesis of proteins in bacteria. Aparently Chloramphenicol interfer during the transfer of amino acids from RNA-bound amino acids to Ribosome
What do you mean by non genetic resistance and how it is acquired?
Tolerance is acquired by compensatory mechanisms in the endocrine and nervous systems.
What harm is caused if you swallow chloramphenicol?
i just did, and if i die tmr...
What is an amphenicol?
An amphenicol is any of a class of antibiotic related to chloramphenicol.
Why is specific resistance mechanisms needed even though nonspecific resistance mechanisms attack all foreign substances?
Specific resistance mechanisms, or adaptive immunity, are essential because they provide a targeted response to particular pathogens, allowing for a more effective elimination of specific threats. While nonspecific resistance mechanisms, such as physical barriers and innate immune responses, offer immediate defense against a wide range of invaders, they lack the ability to remember and adapt to previously encountered pathogens. This specificity enables the immune system to mount a stronger and faster response upon re-exposure to the same pathogen, ultimately improving overall immunity and health.
