0

Subjects>Science>Natural Sciences

What is the structural formula for dichloro diphenyl trichloroethane?

Anonymous

∙ 13y ago

Updated: 6/7/2024

C14H9Cl5.

Wiki User

∙ 13y ago

What else can I help you with?

Continue Learning about Natural Sciences

What is the meaning of DDT chemically?

The meaning of DDT is dichlorodiphenyltrichloroethane. It is a colorless, tasteless and odorless chemical with insecticidal properties. It was first synthesized in 1874.

What is structural formula of 3-oxopentanal?

The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.

How does a complete structural formula differ from condensed formula?

The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.

What is the condensed structural formula for N Methylaniline?

The condensed structural formula for N-methylaniline is CH3C6H4NH2.

What is the difference between structural and condensed formula?

The structural formula show the position of atoms in a molecule.

Related Questions

What is the meaning of DDT chemically?

The meaning of DDT is dichlorodiphenyltrichloroethane. It is a colorless, tasteless and odorless chemical with insecticidal properties. It was first synthesized in 1874.

What is the formula trichloroethane?

Formula: C2H3Cl3

What is the chemical formula of trichloroethane?

C2H3Cl3

What is 1-3-dichloro-3-methylheptane in a condensed structural formula?

CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2

What is the Structural formula for 3-methyl-1-butene?

structural formula of c5h10

What is the structural formula for ethyl butanoate?

The structural formula for ethyl butanoate is CH3CH2CH2COOCH2CH3.

What is the structural formula for aspirin?

The structural formula of aspirin is HOOC-C6H4-OCOCH3(C9H8O4).

What is structural formula of 3-oxopentanal?

The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.

The dichloropropane structural formula and condense formula of di?

The structural formula for dichloropropane is ClCH₂CHCl₂, and its condensed formula is CH₃CHCl₂.

What is the difference between a chemical formulamolecular formula and a structural formula?

A structural formula represents the molecule graphically, whereas the other does not.

How does a complete structural formula differ from condensed formula?

The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.

What is the condensed structural formula for N Methylaniline?

The condensed structural formula for N-methylaniline is CH3C6H4NH2.

Trending Questions

If limestone was crushed what would it do to the rate of reaction between an acid and the limestone? Does a biscuit go through a physical or chemical change? How do I keep tall sedum flowers upright? The average precipitation fall of the transantarctic mountains? How long has bacterial been found living? How do you say sensible in french? In whch area would weathering by frost wedging probably be most effective? What is the relative permittivity of indium arsenide? What city is not located within the American Manufacturing Belt (the Continental Core Region)? Can it snow in North Dakota in April? What pushes food through the digestive tract? Is iron metal the same as just iron? Are catfish unicellular or multi cellular? PH of Dr. pepper? What kind of plate boundaries does mt irazu have? Can a plastic BB make a hole in a cardboard box? Where does the Brazel nut come from? Icd 9 code for hormone imbalance? What was the world smallest battery? What is the biblical meaning of a ring around the moon?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.