answersLogoWhite

0

C14H9Cl5.

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

What is the meaning of DDT chemically?

The meaning of DDT is dichlorodiphenyltrichloroethane. It is a colorless, tasteless and odorless chemical with insecticidal properties. It was first synthesized in 1874.


What is the formula trichloroethane?

Formula: C2H3Cl3


What is the chemical formula of trichloroethane?

C2H3Cl3


What is 1-3-dichloro-3-methylheptane in a condensed structural formula?

CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2


What is the Structural formula for 3-methyl-1-butene?

structural formula of c5h10


What is the structural formula for ethyl butanoate?

The structural formula for ethyl butanoate is CH3CH2CH2COOCH2CH3.


What is the structural formula for aspirin?

The structural formula of aspirin is HOOC-C6H4-OCOCH3(C9H8O4).


What is structural formula of 3-oxopentanal?

The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.


The dichloropropane structural formula and condense formula of di?

The structural formula for dichloropropane is ClCH₂CHCl₂, and its condensed formula is CH₃CHCl₂.


What is the difference between a chemical formulamolecular formula and a structural formula?

A structural formula represents the molecule graphically, whereas the other does not.


How does a complete structural formula differ from condensed formula?

The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.


What is the condensed structural formula for N Methylaniline?

The condensed structural formula for N-methylaniline is CH3C6H4NH2.