Ozone is not a threat to humans at atmosphere. It is something which protects us from UV radiations.
The sun's solar activity has a large impact on the ozone layer. So much so, that a lack of sun hitting the ozone layer near each pole in the winter months causes a thinning we refer to as a hole. This natural event heals itself shortly after the sun returns. A large enough solar flare could cause major issues with this layer, as it did n 1859 (the year of our largest ozone layer "hole"). The use of CFC's is also believed, by some, to help enlarge this event.
There are two reason for the ozone layer to be comparatively thinner in Antarctica than the rest of the world. 1. The polar winds that blow over Antarctica carry the CFCs(Chlorofluorocarbons), that help to break down ozone molecules posing a threat to Earth, to Antarctica. 2. The ice crystals formed above Antarctic in the stratosphere forms a surface for the break down of ozone molecules.
Probably very little would change if you either doubled the magnetic field strength, reversed it, or made it zero. If you reversed it, the larger hole might form over the north pole. UV-C from the Sun makes ozone in the ozone layer, most solar wind (the stuff affected by our magnetic field) does not survive to reach the ozone layer. The poles might retain a bit more ozone into the late spring, with a nearly unmeasureable decrease in overall ozone levels to match.
The ozone layer absorbs and scatters the majority of the Sun's harmful ultraviolet (UV) radiation before it reaches the Earth's surface. This helps to protect us from health issues like skin cancer, cataracts, and immune suppression that can be caused by UV exposure. Without the ozone layer, these harmful UV rays would reach the Earth's surface in much larger quantities, posing a significant threat to humans and other living organisms.
No. The ozone is stratosphere is good ozone. The ozone in troposphere is bad ozone.
CFC's are a major threat to ozone. They react with ozone to deplete it.
The ozone layer is under threat due to the continues use of CFCs. These CFC react with ozone and cause a number of problems.
No. Nitrous oxide is the "dead body" of what could have been an ozone molecule, if water vapor had not gotten to the excited and unstable nitrogen and oxygen "free radical" first. The main threat is water vapor in that case.
Yes, there is a hole in the ozone layer that poses a threat to the environment. The hole in the ozone layer allows harmful ultraviolet radiation from the sun to reach the Earth's surface, which can lead to various environmental and health issues.
Damage to ozone is a threat. It is because it causes the ever damaging UV to enter.
A hole in the ozone is a big threat. It can cause humans and other organisms to extinct.
Yes, there are still holes in the ozone layer that pose a threat to the environment, particularly over Antarctica. These holes are caused by the release of certain chemicals, such as chlorofluorocarbons (CFCs), into the atmosphere. Efforts to reduce the use of these harmful substances have been made, but the ozone layer is still in the process of healing.
The fish in the aquarium developed gill disease, due to ozone depletion in the filter system.
Mario J. Molina, a Mexican scientist, won the Nobel Prize in 1995 (along with Paul J. Crutzen and F. Sherwood Rowland) for studies of the ozone layer and the threat from CFCs (chlorofluorocarbons).
The sun's solar activity has a large impact on the ozone layer. So much so, that a lack of sun hitting the ozone layer near each pole in the winter months causes a thinning we refer to as a hole. This natural event heals itself shortly after the sun returns. A large enough solar flare could cause major issues with this layer, as it did n 1859 (the year of our largest ozone layer "hole"). The use of CFC's is also believed, by some, to help enlarge this event.
There are two reason for the ozone layer to be comparatively thinner in Antarctica than the rest of the world. 1. The polar winds that blow over Antarctica carry the CFCs(Chlorofluorocarbons), that help to break down ozone molecules posing a threat to Earth, to Antarctica. 2. The ice crystals formed above Antarctic in the stratosphere forms a surface for the break down of ozone molecules.
Probably very little would change if you either doubled the magnetic field strength, reversed it, or made it zero. If you reversed it, the larger hole might form over the north pole. UV-C from the Sun makes ozone in the ozone layer, most solar wind (the stuff affected by our magnetic field) does not survive to reach the ozone layer. The poles might retain a bit more ozone into the late spring, with a nearly unmeasureable decrease in overall ozone levels to match.