0
What else can I help you with?
What is threatening the ozone layer?
The sun's solar activity has a large impact on the ozone layer. So much so, that a lack of sun hitting the ozone layer near each pole in the winter months causes a thinning we refer to as a hole. This natural event heals itself shortly after the sun returns. A large enough solar flare could cause major issues with this layer, as it did n 1859 (the year of our largest ozone layer "hole"). The use of CFC's is also believed, by some, to help enlarge this event.
Why is the ozone layer comparatively thinner in antarctica than the rest of the world?
There are two reason for the ozone layer to be comparatively thinner in Antarctica than the rest of the world. 1. The polar winds that blow over Antarctica carry the CFCs(Chlorofluorocarbons), that help to break down ozone molecules posing a threat to Earth, to Antarctica. 2. The ice crystals formed above Antarctic in the stratosphere forms a surface for the break down of ozone molecules.
How is ozone in the stratosphere the same as the troposphere?
No. The ozone is stratosphere is good ozone. The ozone in troposphere is bad ozone.
Without earths magnetic field what would happen to earths ozone?
Probably very little would change if you either doubled the magnetic field strength, reversed it, or made it zero. If you reversed it, the larger hole might form over the north pole. UV-C from the Sun makes ozone in the ozone layer, most solar wind (the stuff affected by our magnetic field) does not survive to reach the ozone layer. The poles might retain a bit more ozone into the late spring, with a nearly unmeasureable decrease in overall ozone levels to match.
What cause troposphereic ozone?
The tropospheric ozone is bad ozone. It acts as a pollutant.
What substance is a major threat to the ozone layer?
CFC's are a major threat to ozone. They react with ozone to deplete it.
Why is the ozone layer under threat?
The ozone layer is under threat due to the continues use of CFCs. These CFC react with ozone and cause a number of problems.
Is nitrous oxide the main ozone threat?
No. Nitrous oxide is the "dead body" of what could have been an ozone molecule, if water vapor had not gotten to the excited and unstable nitrogen and oxygen "free radical" first. The main threat is water vapor in that case.
Is there a hole in the ozone layer that poses a threat to the environment?
Yes, there is a hole in the ozone layer that poses a threat to the environment. The hole in the ozone layer allows harmful ultraviolet radiation from the sun to reach the Earth's surface, which can lead to various environmental and health issues.
Why is damage to the ozone layer such a treat to many organisms?
Damage to ozone is a threat. It is because it causes the ever damaging UV to enter.
What problem does a hole in the ozone cause for humans and other organisms?
A hole in the ozone is a big threat. It can cause humans and other organisms to extinct.
Are there still holes in the ozone layer that pose a threat to the environment?
Yes, there are still holes in the ozone layer that pose a threat to the environment, particularly over Antarctica. These holes are caused by the release of certain chemicals, such as chlorofluorocarbons (CFCs), into the atmosphere. Efforts to reduce the use of these harmful substances have been made, but the ozone layer is still in the process of healing.
How do you use ozone depletion in a sentence?
The fish in the aquarium developed gill disease, due to ozone depletion in the filter system.
Who studied ozone?
Mario J. Molina, a Mexican scientist, won the Nobel Prize in 1995 (along with Paul J. Crutzen and F. Sherwood Rowland) for studies of the ozone layer and the threat from CFCs (chlorofluorocarbons).
What is threatening the ozone layer?
The sun's solar activity has a large impact on the ozone layer. So much so, that a lack of sun hitting the ozone layer near each pole in the winter months causes a thinning we refer to as a hole. This natural event heals itself shortly after the sun returns. A large enough solar flare could cause major issues with this layer, as it did n 1859 (the year of our largest ozone layer "hole"). The use of CFC's is also believed, by some, to help enlarge this event.
Why is the ozone layer comparatively thinner in antarctica than the rest of the world?
There are two reason for the ozone layer to be comparatively thinner in Antarctica than the rest of the world. 1. The polar winds that blow over Antarctica carry the CFCs(Chlorofluorocarbons), that help to break down ozone molecules posing a threat to Earth, to Antarctica. 2. The ice crystals formed above Antarctic in the stratosphere forms a surface for the break down of ozone molecules.
How is ozone in the stratosphere the same as the troposphere?
No. The ozone is stratosphere is good ozone. The ozone in troposphere is bad ozone.
