answersLogoWhite

0

A binary compound consists of two different elements. Among the given options, NaOH (sodium hydroxide) is not a binary compound because it contains three different elements: sodium (Na), oxygen (O), and hydrogen (H). The other compounds (NaCl, H2O, and CH4) each consist of only two elements.

User Avatar

AnswerBot

4mo ago

What else can I help you with?

Related Questions

Is CH or NaCl regarded as an organic molecule?

1. CH is an organic radical. 2. NaCl is an inorganic compound.


Which is a compound that contains carbon C NaCl CH 4 Ca?

The compound that contains carbon is CH₄, which is methane. It consists of one carbon atom bonded to four hydrogen atoms. NaCl (sodium chloride) and Ca (calcium) do not contain carbon.


What type of compound is ch-o-ch-ch-ch?

The compound CH-O-CH-CH-CH is an ether, which is a type of organic compound containing an oxygen atom bonded to two carbon atoms in an alkyl chain. Ethers are characterized by the -O- functional group.


What is the reaction of an organic compound with Na-OH?

The equation for the reactions of the carboxylic acids with NaOh is COOH + NaOH --------> CH 3 COONa + H 2 O. Sodium acetate and water are the products formed.


What is the balanced equation for the reaction of oleic acid and sodium hydroxide?

First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20


What is the correct name for the compound CH3CH2CH(DOUBLE BOND)CH-CH2-CH(DOUBLE BOND)CH-CH?

You think probable to cycloocta-1,5-diene.


What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?

The name of this compound is 2-chlorobutane.


Is CH single bond or double bond?

CH compound does not exist. So it has no bonds.


Which compound formation results by aldol condensation of acetaldehyde?

crotonaldhyde CH3-CH=CH-CHO


What is the equation of 2 iodohexane with sodium methoxide?

The reaction between 2-iodohexane and sodium methoxide will result in the substitution of the iodine atom by the methoxy group. The product formed will be 2-methoxyhexane. The equation for the reaction is 2-iodohexane + sodium methoxide -> 2-methoxyhexane + sodium iodide.


What is the Equation for making alcohol?

Alcohol is the after product of bacteria eating sugar. The first step is to obtain a good source of sugar. This is usually from a plant or grain. Then it is worked on by the yeast and the results can be distilled to make liquor.


What is the chemical compound for PGPR?

R 1 O --(CH 2 --CH(OR 2)--CH 2 O)n--R 3 (II)