0
Pb(NO3)2 + 2KI ==> PbI2 + 2KNO3
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What is the chemical formula for lead nitrate and potassium iodide?
Equation: Pb(NO3)2 + KI ----> PbI2 + KNO3
What is the chemical formula for lead nitrate and potassium iodide reaction?
lead nitrate(Pb(NO3)2 + potassium iodide(KI) = lead iodide(PbI) + potassium nitrate (KNO3)
What is dissociation equation for PbNO3 in water?
Pb(NO3)2----------Pb2+ + 2 (NO3)-
What is the balanced equation for zinc plus lead nitrate yield zinc nitrate plus lead?
Equation is Zn + Pb(NO3)2 --> Zn(NO3)2 + Pb
What is the balance equation for cobalt ll bromide and lead nitrate?
If lead (II), then CoBr2(aq) + Pb(NO3)2(aq) ----> Co(NO3)2(aq) + PbBr2(s) If lead (IV), then 2CoBr2(aq) + Pb(NO3)4(aq) ----> 2Co(NO3)2(aq) + PbBr4(aq)
What is the reaction equation for Pb NO3 2 plus KI?
yhujuhj
What is the chemical formula for lead nitrate and potassium iodide?
Equation: Pb(NO3)2 + KI ----> PbI2 + KNO3
What is the chemical formula for lead nitrate and potassium iodide reaction?
lead nitrate(Pb(NO3)2 + potassium iodide(KI) = lead iodide(PbI) + potassium nitrate (KNO3)
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is dissociation equation for PbNO3 in water?
Pb(NO3)2----------Pb2+ + 2 (NO3)-
What is the chemical equation potassium and lead nitrate react to form potassium lead nitrate and lead?
through a double displacement reaction. 2Ca + Pb(NO3)4 = Pb + 2Ca(NO3)2
What is the balanced equation for zinc plus lead nitrate yield zinc nitrate plus lead?
Equation is Zn + Pb(NO3)2 --> Zn(NO3)2 + Pb
What is the balance equation for cobalt ll bromide and lead nitrate?
If lead (II), then CoBr2(aq) + Pb(NO3)2(aq) ----> Co(NO3)2(aq) + PbBr2(s) If lead (IV), then 2CoBr2(aq) + Pb(NO3)4(aq) ----> 2Co(NO3)2(aq) + PbBr4(aq)
What is the balanced equation for the reaction of solid lead with nitrate?
Pb + 2NO3 - --> Pb(NO3)2
What is the equation for aqueous potassium iodide reacts with lead nitrate in solution forming solid lead iodide?
The chemical equation is:2 KI + Pb(NO3)2 = 2 KNO3 + PbI2(s)
What would the balanced equation be for potassium iodide and lead II nitrates to produce potassium nitrate and lead iodidine?
The balanced equation is 2 KI + Pb(NO3)2 -> 2 KNO3 + PbI2.
Can lead be displaces with zinc in salt solution with equation?
Zinc displaces lead as in this equation:Zn + Pb(NO3)2 = Pb + Zn(NO3)2.
