0
HCH3COO is the same thing as C2H4O2 and is the chemical formula for Acetic Acid.
Wiki User
∙ 8y ago
Wiki User
∙ 6y agoIf you mean (CH3)2CHCH2COO- then this is the 2-methylpropanoate anion.
Wiki User
∙ 15y agoKCH3COO or KC2H3O2 is Potassium acetate
Wiki User
∙ 6y agoI think you mean CH3 CH2 CH2 COOH and that is butyric acid or butanoic acid.
Wiki User
∙ 15y agoPotassium Acetate
Wiki User
∙ 6y agoThis compound is potassium acetate.
Add your answer:
Earn +20 pts
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
What is the difference between 2-hexene and 3-hexene?
The position of double bond is different. CH3-CH=CH-CH2-CH2-CH3 is 2-hexene CH3-CH2-CH=CH-CH2-CH3 is 3-hexene
What is the structure of 3-bromo-2-butanol?
CH3-CH(Br)-CH(OH)-CH3
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
How do you write Zinc Acetate?
2(CH3-COO^-) Zn^(2+).
What is the name of compound CH3 3?
2,2,3-tri-methyl-butane is the name of: (CH3)2-CH-C-(CH3)3 or reversely written: (CH3)3-C-CH-(CH3)2
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
The equation for the reaction between 2-pentene and bromine?
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
Chemical reaction of 2-Butene?
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
What is the difference between 2-hexene and 3-hexene?
The position of double bond is different. CH3-CH=CH-CH2-CH2-CH3 is 2-hexene CH3-CH2-CH=CH-CH2-CH3 is 3-hexene
What is the structure of 3-bromo-2-butanol?
CH3-CH(Br)-CH(OH)-CH3
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the Structural formula of 3-chloro-2-methylpentane?
Ch3ch2ch(ch3)ch2ch=o
Structural formula of CH3-CH equals CH-CO-H?
This is already a structural formula CH3-CH=CH-CHO of 2- butenal or Butanal-2-en
