answersLogoWhite

0

HCH3COO is the same thing as C2H4O2 and is the chemical formula for Acetic Acid.

User Avatar

Wiki User

10y ago

What else can I help you with?

Related Questions

What is the IUPAC name for ch3-ch equals ch-ch3?

The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.


What is the structure of 2-pentanone?

CH3-CH(=O)-CH(CH3)-CH2-CH3


What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?

The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.


What is the name of compound CH3 3?

The compound CH3 is known as methyl group. It is a functional group consisting of a carbon atom bonded to three hydrogen atoms.


What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?

The name of this compound is 2-chlorobutane.


Explain Why a reaction is exothermic or endothermic because of bond energies?

the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH


What is the condensed formula for 223trimethylpentane?

The condensed formula for 2,2,3-trimethylpentane is CH₃C(CH₃)₂CH(CH₃)₂CH₃.


What is the IUPAC name of CH3-CH--CH-CHO?

'But-2-enal' Reason #1 it has the aldehyde functional group at the end of the chain (R- CHO) #2 it has a double carbon-carbon bond on carbon no. 2. Hence the '-en al ' in the spelling as it is an alkene too!!!!!


Chemical reaction of 2-Butene?

2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3


The equation for the reaction between 2-pentene and bromine?

The reaction between 2-pentene and bromine is an addition reaction. The double bond in 2-pentene reacts with bromine to form a dibromoalkane. This reaction proceeds via an electrophilic addition mechanism.


What is condensed formula for 2 3 3 4 tetramethylnonane?

The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.


What is the chemical formula for 2-methyl-2hexene?

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.