0
Alcohol in a triglyceride that 3 fatty acids chains attach to?
Wiki User
∙ 13y ago
Glycerol
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
An alcohol that reacts with fatty acids to form fats?
This alcohol is glycerol. They form lipids when fatty acids attach to them.
What is a compound that has fatty acids and glycerol in it?
triglyceride
When bonded what do fatty acids and glycerol form?
Ester bonds. For example, "A triglyceride (TG, triacylglycerol, TAG, or triacylglyceride) is an ester derived from glycerol and three fatty acids."-wikipedia on triglyceride
What are long chains of amino acids?
Long chains of amino acids are called polypeptides.
How many glycerols in a triglyceride?
1. 3 fatty acids are attached to it.
Alcohol in a triglyceride that three fatty acid chains attach to?
Triglycerides = 3 fatty acids + glycerolGlycerol (also named glycerin or glycerine) has the structural formula of:HOCH2-CH2-CH(OH)-CH2-CH2OHAnd thus you can see the three alcohol groups to which the fatty acid chains are attached to.
What do fatty acids attach to in a triglyceride?
They attach, via ester bonds, to the glycerol (glycerine) backbone.
How is a triglyceride formed?
A triglyceride is made of three long chain fatty acids (hydrocarbons) attached to one molecule of glycerol. The number of hydrocarbons in the chains determine the nature of the triglyceride; all three chains may be the same length, or each a different length.
What is the alcohol found in a triglyceride?
There is no alcohol in a triglyceride, but one is produced when it is hydrolysed. This alcohol is glycerol.
An alcohol that reacts with fatty acids to form fats?
This alcohol is glycerol. They form lipids when fatty acids attach to them.
Glycerol with three fatty acids attached is referred to as?
Three fatty acids attached to one glycerol molecule is called a triglyceride.
What are the unit molecules that make up fat?
The smaller molecules that make up a fat molecule are fatty acids and glycerol. Glycerol is an organic compound and fatty acids are made of chains of hydrocarbons.
What is a compound that has fatty acids and glycerol in it?
triglyceride
When bonded what do fatty acids and glycerol form?
Ester bonds. For example, "A triglyceride (TG, triacylglycerol, TAG, or triacylglyceride) is an ester derived from glycerol and three fatty acids."-wikipedia on triglyceride
What consists of glycerol attached to three fatty acids?
Is the composition of FAT ...Actually, it is a lipid.
A Molecule of three fatty acids and glycerol?
a triglyceride
What are the component of triglyceride?
- Three Fatty Acids and glycerol
